CAS 67283-74-3

4H-1-Benzopyran-2-carboxylic acid

Description:

4H-1-Benzopyran-2-carboxylic acid, also known as coumarin-2-carboxylic acid, is an organic compound characterized by its fused benzene and pyran rings, which contribute to its aromatic properties. This compound features a carboxylic acid functional group, making it a weak acid. It is typically a white to off-white crystalline solid that is soluble in polar solvents like water and alcohols, while being less soluble in non-polar solvents. The presence of the carboxylic acid group allows for hydrogen bonding, influencing its solubility and reactivity. 4H-1-Benzopyran-2-carboxylic acid is of interest in various fields, including medicinal chemistry, due to its potential biological activities, such as anti-inflammatory and antioxidant properties. Additionally, it can serve as a precursor in the synthesis of other chemical compounds. Safety data indicates that, like many organic acids, it should be handled with care to avoid skin and eye irritation. Overall, this compound is significant in both research and industrial applications, particularly in the development of pharmaceuticals and agrochemicals.

Formula: C₁₀H₈O₃

InChI: InChI=1S/C10H8O3/c11-10(12)9-6-5-7-3-1-2-4-8(7)13-9/h1-4,6H,5H2,(H,11,12)

InChI key: InChIKey=VEKQSHDKCBTWRO-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1OC=2C(CC1)=CC=CC2

Synonyms:

• 4H-1-Benzopyran-2-carboxylic acid

4H-Chromene-2-carboxylic acid

CAS: 67283-74-3

4H-Chromene-2-carboxylic acid

Purity: ≥95%

Molecular weight: 176.17g/mol

Ref: 54-OR55166