CAS 672937-60-9
:2-(Dicyclohexylphosphino)-1-phenyl-1H-pyrrole
Description:
2-(Dicyclohexylphosphino)-1-phenyl-1H-pyrrole, with the CAS number 672937-60-9, is a chemical compound that features a pyrrole ring substituted with a phenyl group and a dicyclohexylphosphino moiety. This compound is characterized by its unique structure, which combines both phosphorus and nitrogen functionalities, making it a potential ligand in coordination chemistry and catalysis. The presence of the dicyclohexylphosphino group enhances its steric and electronic properties, allowing it to stabilize metal complexes effectively. Additionally, the pyrrole ring contributes to its aromatic character, which can influence its reactivity and interaction with other chemical species. This compound is typically used in organic synthesis and may play a role in various catalytic processes, particularly in transition metal catalysis. Its physical properties, such as solubility and melting point, can vary based on the specific conditions and purity of the sample. Overall, this compound exemplifies the intersection of organic and inorganic chemistry, showcasing the versatility of phosphine ligands in modern chemical applications.
Formula:C22H30NP
InChI:InChI=1S/C22H30NP/c1-4-11-19(12-5-1)23-18-10-17-22(23)24(20-13-6-2-7-14-20)21-15-8-3-9-16-21/h1,4-5,10-12,17-18,20-21H,2-3,6-9,13-16H2
SMILES:c1ccc(cc1)n1cccc1P(C1CCCCC1)C1CCCCC1
Synonyms:- Dicyclohexyl-(1-Phenylpyrrol-2-Yl)Phosphane
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2-(dicyclohexylphosphanyl)-1-phenyl-1H-pyrrole
CAS:Formula:C22H30NPPurity:98%Color and Shape:SolidMolecular weight:339.45412-(Dicyclohexylphosphino)-1-phenyl-1H-pyrrole
CAS:2-(Dicyclohexylphosphino)-1-phenyl-1H-pyrrolePurity:98%Molecular weight:339.46g/molN-Phenyl-2-(dicyclohexylphosphino)pyrrole, 90% [cataCXium® PCy]
CAS:N-Phenyl-2-(dicyclohexylphosphino)pyrrole, 90% [cataCXium® PCy]
Formula:C22H30NPPurity:90%Color and Shape:white to yellow pwdr.Molecular weight:339.45N-Phenyl-2-(dicyclohexylphosphino)pyrrole
CAS:N-Phenyl-2-(dicyclohexylphosphino)pyrrole is a palladium catalyst used in organic synthesis. It is soluble in anhydrous solvents and is selective for reactions that require chloride as the source of the leaving group, such as cyanoacetic acid and phenylbutyrate. N-Phenyl-2-(dicyclohexylphosphino)pyrrole can be prepared by reacting bromobenzene with dimethyl acetylenedicarboxylate followed by treatment with ammonium chloride and heating at reflux. The reaction product can be isolated by precipitation from a mixture of ethanol and water.Formula:C22H30NPPurity:Min. 95%Molecular weight:339.45 g/mol




