CAS 67295-24-3

3-Pyridinecarboxaldehyde, 2-(methylamino)-, hydrochloride (1:1)

Description:

3-Pyridinecarboxaldehyde, 2-(methylamino)-, hydrochloride (1:1), with the CAS number 67295-24-3, is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features a carboxaldehyde functional group and a methylamino group, contributing to its reactivity and potential applications in organic synthesis and medicinal chemistry. As a hydrochloride salt, it is typically encountered in a solid form, which enhances its stability and solubility in aqueous solutions. The presence of the methylamino group suggests potential biological activity, making it of interest in pharmaceutical research. The compound may exhibit properties such as being a weak base due to the nitrogen atom in the pyridine ring, and it can participate in various chemical reactions, including nucleophilic additions and condensation reactions. Safety data should be consulted for handling, as with all chemical substances, to ensure proper precautions are taken during use.

Formula: C₇H₈N₂O·ClH

InChI: InChI=1S/C7H8N2O.ClH/c1-8-7-6(5-10)3-2-4-9-7;/h2-5H,1H3,(H,8,9);1H

InChI key: InChIKey=AIMLWSCSYNLFQI-UHFFFAOYSA-N

SMILES: C(=O)C1=C(NC)N=CC=C1.Cl

Synonyms:

• 3-Pyridinecarboxaldehyde, 2-(methylamino)-, monohydrochloride
• 3-Pyridinecarboxaldehyde, 2-(methylamino)-, hydrochloride (1:1)

2-(methylamino)nicotinaldehyde hydrochloride

CAS: 67295-24-3

Formula: C₇H₉ClN₂O

Purity: 95.0%

Molecular weight: 172.61

Ref: 10-F358879