CAS 672950-90-2
:N1,N1-Dimethyl-N2-[3-phenyl-6-(trifluoromethyl)-1,2,4-triazin-5-yl]-1,2-ethanediamine
Description:
N1,N1-Dimethyl-N2-[3-phenyl-6-(trifluoromethyl)-1,2,4-triazin-5-yl]-1,2-ethanediamine, identified by its CAS number 672950-90-2, is a chemical compound characterized by its complex structure, which includes a triazine ring and a dimethylated ethylenediamine moiety. This compound features a trifluoromethyl group, which often enhances lipophilicity and biological activity. The presence of the phenyl group contributes to its aromatic characteristics, potentially influencing its interactions in biological systems. The triazine core is known for its applications in agrochemicals and pharmaceuticals, often exhibiting herbicidal or fungicidal properties. The dimethylated amine groups may enhance solubility and reactivity, making it suitable for various chemical reactions. Overall, this compound's unique structural features suggest potential utility in medicinal chemistry and agricultural applications, although specific biological activity and toxicity profiles would require further investigation through empirical studies.
Formula:C14H16F3N5
InChI:InChI=1S/C14H16F3N5/c1-22(2)9-8-18-13-11(14(15,16)17)20-21-12(19-13)10-6-4-3-5-7-10/h3-7H,8-9H2,1-2H3,(H,18,19,21)
InChI key:InChIKey=PKQXZEBBMUPTPF-UHFFFAOYSA-N
SMILES:N(CCN(C)C)C=1C(C(F)(F)F)=NN=C(N1)C2=CC=CC=C2
Synonyms:- N1,N1-Dimethyl-N2-[3-phenyl-6-(trifluoromethyl)-1,2,4-triazin-5-yl]-1,2-ethanediamine
- 1,2-Ethanediamine, N1,N1-dimethyl-N2-[3-phenyl-6-(trifluoromethyl)-1,2,4-triazin-5-yl]-
- 1,2-Ethanediamine, N,N-dimethyl-N′-[3-phenyl-6-(trifluoromethyl)-1,2,4-triazin-5-yl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.