CymitQuimica logo

CAS 673-08-5

:

tyr-gly

Description:
The chemical substance known as "tyr-gly," with the CAS number 673-08-5, is a dipeptide composed of the amino acids tyrosine (Tyr) and glycine (Gly). It is characterized by its structure, which features a peptide bond linking the carboxyl group of tyrosine to the amino group of glycine. Tyr-gly exhibits properties typical of peptides, such as solubility in water and the ability to participate in various biochemical reactions. It may play a role in biological processes, including neurotransmission and metabolic pathways, due to the presence of tyrosine, which is a precursor for neurotransmitters like dopamine. Additionally, the presence of glycine contributes to its stability and potential interactions in biological systems. Tyr-gly can be synthesized through peptide coupling methods and is often used in research and pharmaceutical applications to study peptide behavior and function. Its characteristics, including molecular weight and specific reactivity, are influenced by the properties of its constituent amino acids.
Formula:C11H14N2O4
InChI:InChI=1/C11H14N2O4/c12-9(11(17)13-6-10(15)16)5-7-1-3-8(14)4-2-7/h1-4,9,14H,5-6,12H2,(H,13,17)(H,15,16)/t9-/m0/s1
InChI key:HPYDSVWYXXKHRD-VIFPVBQESA-N
SMILES:c1cc(ccc1C[C@@H](C(=NCC(=O)O)O)N)O
Synonyms:
  • H-Tyr-Gly-OH
  • L-Tyrosylglycine
  • Tyrosylglycine
  • D-tyrosylglycine
  • {[(2S)-2-ammonio-3-(4-hydroxyphenyl)propanoyl]amino}acetate
Found 3 products.