CAS 67303-24-6

(2Z)-N-(5-chloro-2-methoxyphenyl)-2-(hydroxyimino)ethanamide

Description:

(2Z)-N-(5-chloro-2-methoxyphenyl)-2-(hydroxyimino)ethanamide, with CAS number 67303-24-6, is a chemical compound characterized by its unique structural features. It contains a chloro-substituted aromatic ring, which contributes to its potential biological activity, and a hydroxyimino functional group that can participate in various chemical reactions. The presence of the methoxy group enhances its lipophilicity, potentially influencing its solubility and permeability in biological systems. This compound is likely to exhibit specific interactions with biological targets due to its functional groups, making it of interest in medicinal chemistry. Its structural configuration, particularly the Z-isomerism at the double bond, may affect its reactivity and biological properties. Overall, this compound's characteristics suggest potential applications in pharmaceuticals or agrochemicals, although specific biological activities and mechanisms would require further investigation through experimental studies.

Formula: C₉H₉ClN₂O₃

InChI: InChI=1/C9H9ClN2O3/c1-15-8-3-2-6(10)4-7(8)12-9(13)5-11-14/h2-5,14H,1H3,(H,12,13)/b11-5-

SMILES: COc1ccc(cc1N=C(/C=N\O)O)Cl

N-(5-Chloro-2-methoxyphenyl)-2-(N-hydroxyimino)acetamide

CAS: 67303-24-6

Versatile small molecule scaffold

Formula: C₉H₉ClN₂O₃

Purity: Min. 95%

Molecular weight: 228.63 g/mol

Ref: 3D-SCA30324