CAS 67309-95-9

(3R,4R,6aS)-7-(propan-2-ylidene)octahydro-3,9a-methanocyclopenta[c]oxocine-4(1H)-carboperoxoic acid

Description:

The chemical substance known as "(3R,4R,6aS)-7-(propan-2-ylidene)octahydro-3,9a-methanocyclopenta[c]oxocine-4(1H)-carboperoxoic acid," with the CAS number 67309-95-9, is a complex organic compound characterized by its unique bicyclic structure. This compound features multiple stereocenters, which contribute to its specific three-dimensional configuration and potentially influence its biological activity. The presence of a carboperoxoic acid functional group suggests that it may exhibit properties typical of peracids, such as strong oxidizing capabilities. The bicyclic framework, combined with the presence of an isopropenyl group, may impart specific reactivity patterns, making it of interest in synthetic organic chemistry and potentially in medicinal chemistry. Its stereochemistry and functional groups could also play a role in interactions with biological targets, making it a candidate for further investigation in pharmacological studies. Overall, this compound's structural complexity and functional diversity highlight its potential applications in various chemical and biological contexts.

Formula: C₁₅H₂₂O₄

InChI: InChI=1/C15H22O4/c1-9(2)10-5-6-15-7-13(18-8-15)11(14(16)19-17)3-4-12(10)15/h11-13,17H,3-8H2,1-2H3/t11-,12+,13-,15?/m1/s1

Aspterric acid

CAS: 67309-95-9

Aspterric acid is a useful organic compound for research related to life sciences. The catalog number is T124423 and the CAS number is 67309-95-9.

Formula: C₁₅H₂₂O₄

Color and Shape: Solid

Molecular weight: 266.337

Ref: TM-T124423

Aspterric Acid

CAS: 67309-95-9

Aspterric Acid

Color and Shape: Solid

Molecular weight: 266.33g/mol

Ref: 54-BIM1106

Aspterric acid

CAS: 67309-95-9

Formula: C₁₅H₂₂O₄

Purity: ≥ 95.0%

Color and Shape: White solid

Molecular weight: 266.33

Ref: 7W-GL9151

Aspterric acid

CAS: 67309-95-9

Plant growth regulator

Formula: C₁₅H₂₂O₄

Purity: Min. 95%

Molecular weight: 266.33 g/mol

Ref: 3D-AA166533