CAS 67314-34-5: Hexa-O-acetyl-maltal
Description:Hexa-O-acetyl-maltal, with the CAS number 67314-34-5, is a chemical compound derived from maltose, a disaccharide sugar. This compound is characterized by the presence of six acetyl groups attached to the maltal structure, which enhances its solubility and stability compared to its parent molecule. Hexa-O-acetyl-maltal is typically a white to off-white crystalline solid, exhibiting a sweet taste due to its sugar origins. It is soluble in organic solvents such as chloroform and acetone, but less soluble in water due to the hydrophobic nature of the acetyl groups. This compound is often used in organic synthesis and as an intermediate in the production of various chemical derivatives. Its acetylation modifies the reactivity of the hydroxyl groups, making it useful in various applications, including pharmaceuticals and food chemistry. As with many acetylated compounds, it may exhibit different physical and chemical properties compared to its unmodified counterparts, influencing its behavior in biological systems and industrial processes.
Formula:C24H32O15
InChI:InChI=1/C24H32O15/c1-11(25)32-9-18-20(17(7-8-31-18)34-13(3)27)39-24-23(37-16(6)30)22(36-15(5)29)21(35-14(4)28)19(38-24)10-33-12(2)26/h7-8,17-24H,9-10H2,1-6H3/t17-,18-,19-,20+,21-,22+,23-,24-/m1/s1
- Synonyms:
- 3,6-di-O-acetyl-1,5-anhydro-2-deoxy-4-O-(2,3,4,6-tetra-O-acetyl-alpha-D-glucopyranosyl)-D-arabino-hex-1-enitol
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | Hexa-O-acetylmaltal REF: 7W-GC5536CAS: 67314-34-5 | - - - | To inquire | Wed 13 Aug 25 |
![]() | Hexa-O-acetylmaltal REF: 3D-OH03730CAS: 67314-34-5 | Min. 95% | 186.00 €~1,494.00 € | Tue 23 Sep 25 |

Hexa-O-acetylmaltal
Ref: 3D-OH03730
1g | 343.00 € | ||
2g | 478.00 € | ||
5g | 962.00 € | ||
10g | 1,494.00 € | ||
500mg | 186.00 € |