CAS 6735-33-7

[(3-methyl-2,6-dioxo-7-propyl-2,3,6,7-tetrahydro-1H-purin-8-yl)sulfanyl]acetate

Description:

The chemical substance with the name "[(3-methyl-2,6-dioxo-7-propyl-2,3,6,7-tetrahydro-1H-purin-8-yl)sulfanyl]acetate" and CAS number 6735-33-7 is a purine derivative characterized by its complex structure, which includes a purine ring system substituted with a sulfanyl group and an acetate moiety. This compound features a tetrahydro configuration, indicating it has a saturated ring structure, and it contains both keto groups and a methyl group, contributing to its unique reactivity and potential biological activity. The presence of the sulfanyl group suggests potential for nucleophilic reactions, while the acetate group may influence solubility and reactivity in biological systems. Such compounds are often of interest in medicinal chemistry due to their potential roles as pharmaceuticals or biochemical probes. The specific properties, such as solubility, melting point, and reactivity, would depend on the molecular interactions and the environment in which the compound is studied.

Formula: C₁₁H₁₃N₄O₄S

InChI: InChI=1/C11H14N4O4S/c1-3-4-15-7-8(12-11(15)20-5-6(16)17)14(2)10(19)13-9(7)18/h3-5H2,1-2H3,(H,16,17)(H,13,18,19)/p-1

tert-Butyl 3-phenoxyazetidine-1-carboxylate

CAS: 6735-33-7

Tert-butyl 3-phenoxyazetidine-1-carboxylate is a boronate ester that can be used in the coupling of arylboronic acids. It reacts with aryl halides or triflates to form a new carbon-carbon bond. This reaction proceeds through the formation of an intermediate, phenoxyacetylene. The tertiary alcohol group on the tert-butyl 3-phenoxyazetidine-1-carboxylate molecule is then attacked by the carbonyl carbon atom on the phenoxyacetylene intermediate to form a new carbon-carbon bond. This reaction can be catalyzed with palladium and copper catalysis.

Formula: C₁₄H₁₉NO₃

Purity: Min. 95%

Molecular weight: 249.3 g/mol

Ref: 3D-GAA73533