CAS 67354-34-1
:Butanoic acid, 3-oxo-4-(phenylmethoxy)-, ethyl ester
Description:
Butanoic acid, 3-oxo-4-(phenylmethoxy)-, ethyl ester, identified by CAS number 67354-34-1, is an organic compound characterized by its ester functional group, which is derived from butanoic acid and an aromatic phenylmethoxy moiety. This compound typically exhibits a moderate molecular weight and is likely to be a colorless to pale yellow liquid at room temperature. It is expected to have a pleasant, fruity odor, common to many esters. The presence of the phenylmethoxy group suggests potential for aromatic interactions, which may influence its solubility and reactivity. In terms of chemical behavior, butanoic acid derivatives often participate in reactions typical of esters, such as hydrolysis and transesterification. The compound may also exhibit biological activity, making it of interest in fields such as pharmaceuticals or agrochemicals. Safety data should be consulted for handling and storage, as esters can vary in toxicity and reactivity. Overall, this compound represents a unique structure with potential applications in various chemical industries.
Formula:C13H16O4
InChI:InChI=1S/C13H16O4/c1-2-17-13(15)8-12(14)10-16-9-11-6-4-3-5-7-11/h3-7H,2,8-10H2,1H3
InChI key:DXUTWLTWGKEWJA-UHFFFAOYSA-N
SMILES:CCOC(=O)CC(=O)COCC1=CC=CC=C1
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
Ethyl 4-(benzyloxy)-3-oxobutanoate
CAS:Ethyl 4-(benzyloxy)-3-oxobutanoateFormula:C13H16O4Purity:97%Molecular weight:236.267Ethyl 4-(benzyloxy)-3-oxobutanoate
CAS:Formula:C13H16O4Purity:95%Color and Shape:LiquidMolecular weight:236.2637Ethyl 4-(benzyloxy)-3-oxobutanoate
CAS:Formula:C13H16O4Purity:95%Color and Shape:LiquidMolecular weight:236.267Ethyl 4-(benzyloxy)-3-oxobutanoate
CAS:Ethyl 4-(benzyloxy)-3-oxobutanoateFormula:C13H16O4Purity:95%Molecular weight:236.26Ethyl 4-(benzyloxy)-3-oxobutanoate
CAS:Ethyl 4-(benzyloxy)-3-oxobutanoate is a molecule that belongs to the group of prebiotics. It is a levulinate ester of ethyl 3-hydroxybutanoate, which contains an alkyl group. This molecule can be produced by the spontaneous reaction of malonate and levulinate in water. The stereoisomers of this molecule have been synthesized using various methods, including model studies and synthesis methods, such as the Grignard reaction and lithium aluminum hydride reduction. Ethyl 4-(benzyloxy)-3-oxobutanoate has shown enhancement effects for farnesyl diphosphate (FPP) in a rat model, which may be due to its ability to inhibit the enzyme farnesol dehydrogenase.Formula:C13H16O4Purity:Min. 95%Color and Shape:LiquidMolecular weight:236.26 g/mol




