CymitQuimica logo

CAS 67355-26-4

:

1,3-thiazole-2,4-diamine hydrochloride

Description:
1,3-Thiazole-2,4-diamine hydrochloride is an organic compound characterized by its thiazole ring structure, which contains both sulfur and nitrogen atoms. This compound features two amino groups (-NH2) at the 2 and 4 positions of the thiazole ring, contributing to its basicity and potential reactivity. As a hydrochloride salt, it is typically encountered in a crystalline form, which enhances its solubility in water, making it suitable for various applications in pharmaceuticals and biochemistry. The presence of the thiazole moiety often imparts biological activity, and compounds of this class are investigated for their potential as antimicrobial or anticancer agents. Additionally, the compound's stability and reactivity can be influenced by the pH of the environment, and it may participate in various chemical reactions, including acylation and alkylation. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper laboratory practices.
Formula:C3H6ClN3S
InChI:InChI=1S/C3H5N3S/c4-2-1-7-3(5)6-2/h1H,4H2,(H2,5,6)
InChI key:WKXCZMFWXZRMEZ-UHFFFAOYSA-N
SMILES:C1=C(N=C(S1)N)N
Synonyms:
  • 1,3-Thiazole-2,4-diamine hydrochloride (1:1)
Found 2 products.