CAS 67367-24-2

Methyl 4-hydroxynicotinate

Description:

Methyl 4-hydroxynicotinate, with the CAS number 67367-24-2, is an organic compound derived from nicotinic acid. It features a methyl ester functional group and a hydroxyl group attached to the pyridine ring, which contributes to its unique properties. This compound is typically characterized by its white to off-white crystalline appearance and is soluble in polar solvents such as water and ethanol, owing to the presence of the hydroxyl group. Methyl 4-hydroxynicotinate exhibits biological activity, including potential antioxidant properties, and has been studied for its role in various biochemical applications. Its structure allows for interactions with biological systems, making it of interest in pharmaceutical research. Additionally, it may serve as a precursor in the synthesis of other nicotinic derivatives. As with many chemical substances, handling should be done with care, following appropriate safety protocols to mitigate any potential risks associated with exposure.

Formula: C₇H₇NO₃

InChI: InChI=1/C7H7NO3/c1-11-7(10)5-4-8-3-2-6(5)9/h2-4H,1H3,(H,8,9)

SMILES: COC(=O)c1c[nH]ccc1=O

Synonyms:

• 4-Hydroxy-nicotinic acid methyl ester
• 4-Hydroxypyridine-3-carboxylic acid methyl ester
• Methyl 4-Oxo-1,4-Dihydropyridine-3-Carboxylate

Methyl 4-hydroxynicotinate

CAS: 67367-24-2

Formula: C₇H₇NO₃

Purity: 97%

Color and Shape: Solid

Molecular weight: 153.1354

Ref: IN-DA00FAA8

Methyl 4-hydroxynicotinate

CAS: 67367-24-2

Methyl 4-hydroxynicotinate

Purity: 98%

Molecular weight: 153.14g/mol

Ref: 54-OR901986

Methyl 4-hydroxynicotinate

CAS: 67367-24-2

Formula: C₇H₇NO₃

Purity: 98%

Molecular weight: 153.137

Ref: 10-F228147

Methyl 4-Hydroxynicotinate

Controlled Product

CAS: 67367-24-2

Formula: C₇H₇NO₃

Color and Shape: Neat

Molecular weight: 153.135

Ref: TR-M312995