CAS 67368-40-5
:Leucine, N-[(4-methylphenyl)sulfonyl]-
Description:
Leucine, N-[(4-methylphenyl)sulfonyl]- is a chemical compound that features a leucine amino acid backbone modified with a sulfonyl group attached to a para-methylphenyl moiety. This compound is characterized by its sulfonamide functional group, which typically enhances solubility and can influence biological activity. Leucine itself is an essential branched-chain amino acid important for protein synthesis and metabolic functions. The presence of the 4-methylphenyl group may impart specific properties such as increased lipophilicity or altered interaction with biological targets. The compound is likely to exhibit moderate stability under standard conditions, but its reactivity can be influenced by the sulfonyl group, which can participate in various chemical reactions. In terms of applications, derivatives of leucine are often explored in pharmaceuticals and biochemistry for their potential roles in drug design and development, particularly in targeting metabolic pathways or enhancing protein interactions. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity.
Formula:C13H19NO4S
InChI:InChI=1S/C13H19NO4S/c1-9(2)8-12(13(15)16)14-19(17,18)11-6-4-10(3)5-7-11/h4-7,9,12,14H,8H2,1-3H3,(H,15,16)
InChI key:DNBHSCLUHQKGMD-UHFFFAOYSA-N
SMILES:CC1=CC=C(C=C1)S(=O)(=O)NC(CC(C)C)C(=O)O
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
4-Methyl-2-(4-methylbenzenesulfonamido)pentanoic acid
CAS:4-Methyl-2-(4-methylbenzenesulfonamido)pentanoic acid (MBSA) is a synthetic histidine molecule that exhibits specificities for the pancreas. MBSA is converted to chloromethyl ketone when subjected to photooxidation. The mechanism of action of MBSA is postulated to be related to its chemical composition and kinetic properties, which are different from other histidines. Chemical analyses have shown that it has a tryptic pattern and an amino acid composition that is different from other histidines. It has been found that MBSA inactivates spermatozoa in vitro, which may be due to the presence of chloromethylketone on its molecular structure.Formula:C13H19NO4SPurity:Min. 95%Molecular weight:285.36 g/mol
