CymitQuimica logo

CAS 67382-14-3

:

2-bromo-1-(3-methyl-1-benzofuran-2-yl)ethanone

Description:
2-bromo-1-(3-methyl-1-benzofuran-2-yl)ethanone is an organic compound characterized by its unique structure, which includes a bromine atom and a benzofuran moiety. This compound features a ketone functional group, indicated by the ethanone part of its name, which contributes to its reactivity and potential applications in organic synthesis. The presence of the bromine atom enhances its electrophilic character, making it useful in various chemical reactions, such as nucleophilic substitutions. The benzofuran ring system adds to its aromatic stability and can influence its biological activity. Generally, compounds like this may exhibit interesting pharmacological properties, making them subjects of interest in medicinal chemistry. Additionally, the presence of the methyl group on the benzofuran can affect the compound's solubility and interaction with biological targets. As with many organic compounds, the specific physical and chemical properties, such as melting point, boiling point, and solubility, would need to be determined experimentally or sourced from reliable databases for precise applications.
Formula:C11H9BrO2
InChI:InChI=1/C11H9BrO2/c1-7-8-4-2-3-5-10(8)14-11(7)9(13)6-12/h2-5H,6H2,1H3
InChI key:JXQIYMVMYGFMFK-UHFFFAOYSA-N
SMILES:Cc1c2ccccc2oc1C(=O)CBr
Synonyms:
  • Ethanone, 2-Bromo-1-(3-Methyl-2-Benzofuranyl)-
Found 4 products.