CymitQuimica logo

CAS 67385-10-8

:

di-tert-butyl (disulfanediyldiethane-2,1-diyl)biscarbamate

Description:
Di-tert-butyl (disulfanediyldiethane-2,1-diyl)biscarbamate, identified by its CAS number 67385-10-8, is a chemical compound that belongs to the class of carbamates. This substance features a complex molecular structure characterized by the presence of two tert-butyl groups and a disulfide linkage, which contributes to its unique chemical properties. The compound is typically synthesized through specific organic reactions involving carbamate formation and disulfide chemistry. It is known for its potential applications in various fields, including agriculture as a pesticide or herbicide, due to its ability to interact with biological systems. The presence of the disulfide bond may also impart antioxidant properties, making it of interest in materials science and biochemistry. However, detailed studies on its toxicity, environmental impact, and specific applications are essential for understanding its safety profile and regulatory considerations. As with many chemical substances, proper handling and safety measures should be observed when working with di-tert-butyl (disulfanediyldiethane-2,1-diyl)biscarbamate.
Formula:C14H28N2O4S2
InChI:InChI=1/C14H28N2O4S2/c1-13(2,3)19-11(17)15-7-9-21-22-10-8-16-12(18)20-14(4,5)6/h7-10H2,1-6H3,(H,15,17)(H,16,18)
InChI key:HBTMWZADMHBLMY-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=NCCSSCCN=C(O)OC(C)(C)C)O
Found 3 products.