CymitQuimica logo

CAS 6739-80-6

:

4-(2-oxopyrrolidin-1-yl)butanoic acid

Description:
4-(2-Oxopyrrolidin-1-yl)butanoic acid, also known by its CAS number 6739-80-6, is an organic compound characterized by its pyrrolidine ring and a butanoic acid moiety. This substance features a five-membered nitrogen-containing heterocycle, which contributes to its potential biological activity. The presence of the carboxylic acid functional group (-COOH) indicates that it can participate in acid-base reactions and may exhibit polar characteristics, influencing its solubility in water and organic solvents. The compound's structure suggests it may interact with various biological targets, making it of interest in medicinal chemistry and pharmacology. Additionally, its molecular configuration allows for potential applications in the synthesis of more complex molecules or as a building block in drug development. The stability of the compound under standard conditions, along with its reactivity due to the functional groups present, makes it a subject of study in various chemical and biological contexts. Overall, 4-(2-oxopyrrolidin-1-yl)butanoic acid is notable for its unique structural features and potential applications in research and industry.
Formula:C8H13NO3
InChI:InChI=1/C8H13NO3/c10-7-3-1-5-9(7)6-2-4-8(11)12/h1-6H2,(H,11,12)
InChI key:WRDMYTORSDPYMO-UHFFFAOYSA-N
SMILES:C1CC(=O)N(C1)CCCC(=O)O
Synonyms:
  • 1-Pyrrolidinebutanoic acid, 2-oxo-
Found 3 products.