CAS 6741-71-5

5-methyl-4'-thiouridine

Description:

5-Methyl-4'-thiouridine, also known by its CAS number 6741-71-5, is a modified nucleoside that features a methyl group at the 5-position of the ribose sugar and a thiol group at the 4'-position of the uridine base. This compound is characterized by its role in RNA biology, particularly in the modification of tRNA molecules, where it contributes to the stability and functionality of the RNA structure. The presence of the thiol group enhances the nucleoside's ability to participate in hydrogen bonding and may influence the overall conformation of the RNA. 5-Methyl-4'-thiouridine is typically soluble in water and exhibits properties that are influenced by its structural modifications, such as altered base pairing and increased resistance to enzymatic degradation. Its biological significance extends to various cellular processes, including protein synthesis and the regulation of gene expression. As a nucleoside analog, it may also have implications in therapeutic applications, particularly in the development of antiviral and anticancer agents.

Formula: C₁₀H₁₄N₂O₅S

InChI: InChI=1/C10H14N2O5S/c1-4-2-12(10(17)11-8(4)16)9-7(15)6(14)5(3-13)18-9/h2,5-7,9,13-15H,3H2,1H3,(H,11,16,17)/t5-,6-,7-,9-/m1/s1

SMILES: Cc1cn([C@H]2[C@@H]([C@@H]([C@@H](CO)S2)O)O)c(=O)nc1O

5-Methyl-4'-thiouridine

CAS: 6741-71-5

5-Methyl-4'-thiouridine is a Thio-nucleoside.

Formula: C₁₀H₁₄N₂O₅S

Color and Shape: Solid

Molecular weight: 274.29

Ref: TM-TNU0148

5-Methyl-4'-thiouridine

CAS: 6741-71-5

5-Methyl-4'-thiouridine is a novel, synthetic nucleoside that has antiviral and anticancer activities. It is an activator of ribonucleotide reductase and a substrate for diphosphate reductase. 5-Methyl-4'-thiouridine (also known as 5-methyluridine) is used in the synthesis of DNA, RNA, and phosphoramidites. The CAS number for this compound is 6741-71-5.

Purity: Min. 95%

Ref: 3D-NM144673