CAS 6741-88-4
:Inosine, 2′,3′,5′-tribenzoate
Description:
Inosine, 2′,3′,5′-tribenzoate, with the CAS number 6741-88-4, is a chemical compound derived from inosine, a nucleoside that plays a crucial role in various biological processes, including energy transfer and protein synthesis. This compound is characterized by the presence of three benzoate groups esterified to the hydroxyl groups at the 2′, 3′, and 5′ positions of the ribose sugar moiety of inosine. The addition of these benzoate groups enhances the lipophilicity of the molecule, potentially affecting its solubility and permeability in biological systems. Inosine derivatives are often studied for their pharmacological properties, including anti-inflammatory and neuroprotective effects. The compound may also exhibit interesting interactions with nucleic acids and proteins due to its structural modifications. As with many chemical substances, its stability, reactivity, and biological activity can be influenced by environmental factors such as pH and temperature. Overall, inosine, 2′,3′,5′-tribenzoate represents a unique modification of a naturally occurring nucleoside with potential applications in medicinal chemistry and biochemistry.
Formula:C31H24N4O8
InChI:InChI=1S/C31H24N4O8/c36-27-23-26(32-17-33-27)35(18-34-23)28-25(43-31(39)21-14-8-3-9-15-21)24(42-30(38)20-12-6-2-7-13-20)22(41-28)16-40-29(37)19-10-4-1-5-11-19/h1-15,17-18,22,24-25,28H,16H2,(H,32,33,36)/t22-,24-,25-,28-/m1/s1
InChI key:InChIKey=HYIROYSRWYWYBO-ZYWWQZICSA-N
SMILES:O(C(=O)C1=CC=CC=C1)[C@H]2[C@@H](O[C@H](COC(=O)C3=CC=CC=C3)[C@H]2OC(=O)C4=CC=CC=C4)N5C6=C(N=C5)C(=O)N=CN6
Synonyms:- Inosine, 2′,3′,5′-tribenzoate
- 2′,3′,5′-Tri-O-benzoylinosine
- 9-(2′,3′,5′-Tri-O-benzoyl-β-D-ribofuranosyl)hypoxanthine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
