CAS 67412-96-8

(2R)-2-amino-2-(4-methoxyphenyl)acetamide

Description:

(2R)-2-amino-2-(4-methoxyphenyl)acetamide, also known as a derivative of phenylalanine, is an organic compound characterized by its amino acid structure. It features an amine group (-NH2) and a carboxamide group (-C(=O)NH2) attached to a central carbon atom, which is also bonded to a 4-methoxyphenyl group. This compound is typically a white to off-white solid and is soluble in polar solvents such as water and methanol, owing to the presence of the amino and amide functional groups. Its molecular structure allows for potential interactions with biological systems, making it of interest in pharmaceutical research, particularly in the development of drugs targeting specific receptors or enzymes. The methoxy group enhances its lipophilicity, potentially influencing its bioavailability and pharmacokinetics. As with many amino acid derivatives, it may exhibit various biological activities, including neuroprotective effects or modulation of neurotransmitter systems, although specific activities would depend on further empirical studies.

Formula: C₉H₁₂N₂O₂

InChI: InChI=1/C9H12N2O2/c1-13-7-4-2-6(3-5-7)8(10)9(11)12/h2-5,8H,10H2,1H3,(H2,11,12)/t8-/m1/s1

SMILES: COc1ccc(cc1)[C@H](C(=N)O)N

Synonyms:

• benzeneacetamide, α-amino-4-methoxy-, (alphaR)-

R-α-AMINO-4-METHOXYBENZENE ACETAMIDE

CAS: 67412-96-8

Formula: C₉H₁₂N₂O₂

Purity: 97%

Molecular weight: 180.2038

Ref: IN-DA00FCFL

(R)-(-)-4-Methoxy-2-Phenylglycine Amide

CAS: 67412-96-8

(R)-(-)-4-Methoxy-2-Phenylglycine Amide

Purity: ≥95%

Molecular weight: 180.20g/mol

Ref: 54-OR316049

(R)-2-Amino-2-(4-methoxyphenyl)acetamide

CAS: 67412-96-8

Purity: 97%

Molecular weight: 180.2070007

Ref: 10-F763363