CAS 6743-96-0
:Brassicin
Description:
Brassicin, with the CAS number 6743-96-0, is a naturally occurring compound classified as a glucosinolate, which is a type of sulfur-containing compound found primarily in cruciferous vegetables. It is known for its potential health benefits, including anti-cancer properties, attributed to its ability to induce phase II detoxification enzymes. Brassicin is characterized by its structure, which includes a glucose moiety linked to a sulfur-containing aglycone. This compound is typically found in plants such as Brassica species, including broccoli and cabbage. In terms of solubility, brassicin is generally soluble in water due to its polar nature, which is influenced by the presence of the glucose unit. Its stability can be affected by factors such as pH and temperature, and it may undergo hydrolysis to release biologically active compounds. Research into brassicin continues to explore its role in human health, particularly in relation to its antioxidant properties and potential effects on metabolic processes.
Formula:C22H22O12
InChI:InChI=1S/C22H22O12/c1-31-12-4-8(2-3-10(12)24)21-19(29)17(27)15-11(25)5-9(6-13(15)33-21)32-22-20(30)18(28)16(26)14(7-23)34-22/h2-6,14,16,18,20,22-26,28-30H,7H2,1H3/t14-,16-,18+,20-,22-/m1/s1
InChI key:InChIKey=YCUNOXSUHVGZRI-XMHBHJPISA-N
SMILES:O=C1C=2C(OC(=C1O)C3=CC(OC)=C(O)C=C3)=CC(O[C@@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@H]4O)=CC2O
Synonyms:- 4H-1-Benzopyran-4-one, 7-(beta-D-glucopyranosyloxy)-3,5-dihydroxy-2-(4-hydroxy-3-methoxyphenyl)-
- 4H-1-Benzopyran-4-one, 7-(β-<span class="text-smallcaps">D</span>-glucopyranosyloxy)-3,5-dihydroxy-2-(4-hydroxy-3-methoxyphenyl)-
- 7-(beta-D-glucopyranosyloxy)-3,5-dihydroxy-2-(4-hydroxy-3-methoxyphenyl)-4H-1-benzopyran-4-one
- 7-(β-<span class="text-smallcaps">D</span>-Glucopyranosyloxy)-3,5-dihydroxy-2-(4-hydroxy-3-methoxyphenyl)-4H-1-benzopyran-4-one
- Brassicin
- Brassicine
- Flavone, 3,4′,5,7-tetrahydroxy-3′-methoxy-, 7-β-<span class="text-smallcaps">D</span>-glucopyranoside
- Isorhamnetin 7-O-glucoside
- Isorhamnetin 7-O-β-<span class="text-smallcaps">D</span>-glucopyranoside
- Isorhamnetin 7-O-β-glucoside
- Isorhamnetin 7-glucoside
- Flavone, 3,4′,5,7-tetrahydroxy-3′-methoxy-, 7-β-D-glucopyranoside
- 7-(β-D-Glucopyranosyloxy)-3,5-dihydroxy-2-(4-hydroxy-3-methoxyphenyl)-4H-1-benzopyran-4-one
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Brassicin
CAS:Brassicin is a natural flavonoid exhibiting free radical scavenging activity.Formula:C22H22O12Purity:99.12%Color and Shape:SolidMolecular weight:478.4Isorhamnetin 7-o-glucoside
CAS:<p>Isorhamnetin 7-o-glucoside is a flavonoid glucoside, which is commonly derived from various plant sources, such as fruits, vegetables, and certain herbs. Structurally, it is a derivative of isorhamnetin, a well-known flavonoid aglycone, conjugated with a glucose molecule at the 7th position. This compound is part of a larger family of naturally occurring polyphenolic substances that contribute to the pigmentation of plants and serve protective roles.</p>Formula:C22H22O12Purity:Min. 95%Color and Shape:PowderMolecular weight:478.40 g/mol


