CAS 67445-86-7

2-Bromo-N-[4-chloro-2-(4-hydroxybenzoyl)phenyl]acetamide

Description:

2-Bromo-N-[4-chloro-2-(4-hydroxybenzoyl)phenyl]acetamide is a chemical compound characterized by its complex structure, which includes a bromine atom, a chloro substituent, and a hydroxybenzoyl group. This compound features an acetamide functional group, indicating that it is an amide derivative. The presence of the bromine and chlorine atoms suggests that it may exhibit unique reactivity and potential biological activity, possibly serving as a pharmaceutical intermediate or a research chemical. The hydroxy group contributes to its solubility in polar solvents and may influence its interaction with biological targets. Additionally, the compound's structure suggests potential for hydrogen bonding due to the hydroxyl group, which could affect its physical properties such as melting point and solubility. Overall, 2-Bromo-N-[4-chloro-2-(4-hydroxybenzoyl)phenyl]acetamide is a halogenated aromatic compound with potential applications in medicinal chemistry and material science, although specific applications would depend on further research and characterization.

Formula: C₁₅H₁₁BrClNO₃

InChI: InChI=1S/C15H11BrClNO3/c16-8-14(20)18-13-6-3-10(17)7-12(13)15(21)9-1-4-11(19)5-2-9/h1-7,19H,8H2,(H,18,20)

InChI key: InChIKey=MLFFIHLOTFLMSO-UHFFFAOYSA-N

SMILES: C(=O)(C1=C(NC(CBr)=O)C=CC(Cl)=C1)C2=CC=C(O)C=C2

Synonyms:

• 2-Bromo-N-[4-chloro-2-(4-hydroxybenzoyl)phenyl]acetamide
• Acetamide, 2-bromo-N-[4-chloro-2-(4-hydroxybenzoyl)phenyl]-

2-Bromo-N-[4-chloro-2-(4-hydroxybenzoyl)phenyl]acetamide

CAS: 67445-86-7

Formula: C₁₅H₁₁BrClNO₃

Molecular weight: 368.61

Ref: ST-EA-CP-D18025