CymitQuimica logo

CAS 6745-33-1

:

3-pentofuranosylpyrimidine-2,4(1H,3H)-dione

Description:
3-Pentofuranosylpyrimidine-2,4(1H,3H)-dione, with the CAS number 6745-33-1, is a nucleoside analog that features a pyrimidine base linked to a pentofuranosyl sugar. This compound is characterized by its structural components, which include a furanose sugar moiety and a pyrimidine ring that contains two carbonyl groups, contributing to its diketone functionality. The presence of these functional groups can influence its reactivity and biological activity, making it of interest in medicinal chemistry, particularly in the development of antiviral or anticancer agents. The compound's solubility, stability, and interaction with biological macromolecules are critical for its potential applications. Additionally, its molecular structure allows for various modifications that can enhance its pharmacological properties. Overall, 3-pentofuranosylpyrimidine-2,4(1H,3H)-dione represents a significant class of compounds in the study of nucleoside derivatives and their therapeutic potential.
Formula:C9H12N2O6
InChI:InChI=1/C9H12N2O6/c12-3-4-6(14)7(15)8(17-4)11-5(13)1-2-10-9(11)16/h1-2,4,6-8,12,14-15H,3H2,(H,10,16)
SMILES:c1cnc(n(c1=O)C1C(C(C(CO)O1)O)O)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.