CAS 6745-77-3

4-Methoxysalicylamide

Description:

4-Methoxysalicylamide is an organic compound characterized by its salicylamide structure, which features a methoxy group (-OCH3) at the para position relative to the amide functional group. This compound typically appears as a white to off-white crystalline solid and is soluble in organic solvents, with limited solubility in water. Its molecular formula is C9H11NO3, indicating the presence of carbon, hydrogen, nitrogen, and oxygen atoms. The compound exhibits properties associated with both salicylic acid derivatives and amides, making it of interest in various chemical and pharmaceutical applications. It may possess biological activities, including anti-inflammatory or analgesic effects, similar to other salicylamide derivatives. The presence of the methoxy group can influence its reactivity and interaction with biological targets. As with many organic compounds, handling should be done with care, considering potential toxicity and environmental impact. Overall, 4-Methoxysalicylamide serves as a valuable compound in research and development within the fields of medicinal chemistry and pharmacology.

Formula: C₈H₉NO₃

InChI: InChI=1/C8H9NO3/c1-12-5-2-3-6(8(9)11)7(10)4-5/h2-4,10H,1H3,(H2,9,11)

SMILES: COc1ccc(c(c1)O)C(=N)O

Synonyms:

• 2-Hydroxy-4-Methoxybenzamide

2-Hydroxy-4-methoxybenzamide

CAS: 6745-77-3

Formula: C₈H₉NO₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 167.1620

Ref: IN-DA003LP3

2-Hydroxy-4-Methoxybenzamide

CAS: 6745-77-3

2-Hydroxy-4-Methoxybenzamide

Purity: 98%

Molecular weight: 167.16g/mol

Ref: 54-OR1010472

2-Hydroxy-4-methoxybenzamide

CAS: 6745-77-3

Formula: C₈H₉NO₃

Purity: 95%

Molecular weight: 167.164

Ref: 10-F329574