CAS 67450-45-7

(Z)-but-2-enedioate; N-(3,4-dichlorophenyl)-N-[(1R,2R)-2-dimethylaminocyclopentyl]propanamide

Description:

The chemical substance known as (Z)-but-2-enedioate; N-(3,4-dichlorophenyl)-N-[(1R,2R)-2-dimethylaminocyclopentyl]propanamide, with the CAS number 67450-45-7, exhibits several notable characteristics. This compound features a butenedioate moiety, indicating the presence of a double bond and two carboxylate groups, which contribute to its reactivity and potential as a building block in organic synthesis. The presence of the N-(3,4-dichlorophenyl) group suggests significant lipophilicity and potential biological activity, as chlorinated aromatic compounds often exhibit unique pharmacological properties. Additionally, the (1R,2R)-2-dimethylaminocyclopentyl substituent introduces steric hindrance and may influence the compound's interaction with biological targets. The stereochemistry indicated by the (Z) configuration and the specific chiral centers suggests that the compound may exhibit specific optical activity, which can be crucial in determining its biological efficacy and safety profile. Overall, this compound's structural features suggest potential applications in medicinal chemistry and pharmacology, warranting further investigation into its properties and effects.

Formula: C₂₀H₂₄Cl₂N₂O₅

InChI: InChI=1/C16H22Cl2N2O.C4H4O4/c1-4-16(21)20(11-8-9-12(17)13(18)10-11)15-7-5-6-14(15)19(2)3;5-3(6)1-2-4(7)8/h8-10,14-15H,4-7H2,1-3H3;1-2H,(H,5,6)(H,7,8)/p-2/b;2-1-/t14-,15-;/m1./s1

Eclanamine maleate

CAS: 67450-45-7

Eclanamine found to be mildly mutagenic in AS52 test, evaluated in various short-term genetic assays.

Formula: C₂₀H₂₆Cl₂N₂O₅

Color and Shape: Solid

Molecular weight: 445.34

Ref: TM-T31601