CymitQuimica logo

CAS 67451-81-4

:

3-(morpholin-4-ium-4-ylmethyl)benzoate

Description:
3-(Morpholin-4-ium-4-ylmethyl)benzoate, with the CAS number 67451-81-4, is a chemical compound characterized by its morpholinium structure, which includes a morpholine ring substituted with a benzoate group. This compound typically exhibits properties associated with ionic compounds due to the presence of the quaternary ammonium ion, which can influence its solubility and reactivity. It is likely to be soluble in polar solvents, such as water, owing to its ionic nature. The benzoate moiety contributes to its potential applications in various fields, including pharmaceuticals and materials science, where it may function as a surfactant or a stabilizing agent. Additionally, the morpholinium group can impart biological activity, making it of interest in medicinal chemistry. The compound's stability, reactivity, and interaction with biological systems can be influenced by factors such as pH and temperature, which are essential considerations in its practical applications. Overall, 3-(morpholin-4-ium-4-ylmethyl)benzoate represents a versatile chemical entity with potential utility in diverse scientific domains.
Formula:C12H15NO3
InChI:InChI=1/C12H15NO3/c14-12(15)11-3-1-2-10(8-11)9-13-4-6-16-7-5-13/h1-3,8H,4-7,9H2,(H,14,15)
InChI key:LZLRLAYVCUNAEX-UHFFFAOYSA-N
SMILES:c1cc(cc(c1)C(=O)O)CN1CCOCC1
Synonyms:
  • 3-(Morpholin-4-ylmethyl)benzoic acid
  • Benzoic acid, 3-(4-morpholinylmethyl)-
Found 4 products.