CAS 67455-41-8
:4-Piperazinoaniline
Description:
4-Piperazinoaniline, with the CAS number 67455-41-8, is an organic compound characterized by the presence of a piperazine ring and an aniline moiety. This compound typically appears as a solid and is known for its potential applications in pharmaceuticals and organic synthesis. The piperazine group contributes to its basicity and ability to form hydrogen bonds, which can enhance its solubility in various solvents. The aniline part of the molecule provides aromatic characteristics and can participate in electrophilic substitution reactions. 4-Piperazinoaniline may exhibit biological activity, making it of interest in medicinal chemistry, particularly in the development of drugs targeting neurological or psychiatric conditions. Its chemical structure allows for various modifications, which can lead to derivatives with altered properties and activities. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken. Overall, 4-Piperazinoaniline is a versatile compound with significant potential in research and application.
Formula:C10H15N3
InChI:InChI=1/C10H15N3/c11-9-1-3-10(4-2-9)13-7-5-12-6-8-13/h1-4,12H,5-8,11H2
SMILES:c1cc(ccc1N)N1CCNCC1
Synonyms:- 1-(4-Aminophenyl)piperazine
- 4-(Piperazin-1-Yl)Aniline
- 4-(4-Aminophenyl)piperazine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
4-(1-Piperazinyl)aniline, 95%
CAS:4-Piperazinoaniline(CAS#67455-41-8)is a important organic intermediate. It can be used in agrochemical, pharmaceutical and dyestuff field. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to theFormula:C10H15N3Purity:95%Color and Shape:SolidMolecular weight:177.25Benzenamine,4-(1-piperazinyl)-
CAS:Formula:C10H15N3Purity:97%Color and Shape:SolidMolecular weight:177.24624-Piperazin-1-ylaniline
CAS:4-Piperazin-1-ylanilineFormula:C10H15N3Purity:98%Color and Shape: brown solidMolecular weight:177.25g/mol4-Piperazin-1-yl-phenylamine
CAS:Formula:C10H15N3Purity:97%Color and Shape:SolidMolecular weight:177.251



