CAS 67466-31-3

3-(4-bromophenyl)pyrrolidin-3-ol hydrochloride

Description:

3-(4-bromophenyl)pyrrolidin-3-ol hydrochloride is a chemical compound characterized by its unique structure, which includes a pyrrolidine ring substituted with a 4-bromophenyl group and a hydroxyl group. This compound is typically a white to off-white crystalline solid, and it is soluble in water and various organic solvents, making it useful in pharmaceutical applications. The presence of the bromine atom enhances its biological activity and can influence its pharmacokinetic properties. As a hydrochloride salt, it is often more stable and easier to handle than its free base form. This compound may exhibit various biological activities, including potential effects on the central nervous system, and is of interest in medicinal chemistry for the development of therapeutic agents. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper laboratory practices are followed.

Formula: C₁₀H₁₃BrClNO

InChI: InChI=1/C10H12BrNO.ClH/c11-9-3-1-8(2-4-9)10(13)5-6-12-7-10;/h1-4,12-13H,5-7H2;1H

3-(4-Bromophenyl)-3-pyrrolidinol hydrochloride

CAS: 67466-31-3

Formula: C₁₀H₁₃BrClNO

Purity: 95%

Color and Shape: Solid

Molecular weight: 278.5733

Ref: IN-DA024VCN

3-(4-Bromophenyl)pyrrolidin-3-ol hydrochloride

CAS: 67466-31-3

Versatile small molecule scaffold

Formula: C₁₀H₁₃BrClNO

Purity: Min. 95%

Molecular weight: 278.57 g/mol

Ref: 3D-SCA46631