CAS 67467-96-3

2-methyl-3-[4-(2-methylbutan-2-yl)phenyl]propanal

Description:

2-Methyl-3-[4-(2-methylbutan-2-yl)phenyl]propanal, with the CAS number 67467-96-3, is an organic compound characterized by its complex structure, which includes a propanal group and a substituted phenyl ring. This compound features a branched alkyl chain, specifically a 2-methylbutan-2-yl group, attached to the phenyl ring, contributing to its hydrophobic characteristics. The presence of the aldehyde functional group (propanal) indicates that it can participate in various chemical reactions, such as oxidation and condensation. The compound is likely to be a colorless to pale yellow liquid at room temperature, with a distinctive odor typical of aldehydes. Its solubility is expected to be higher in organic solvents than in water due to its hydrophobic nature. Additionally, the presence of multiple functional groups suggests potential applications in organic synthesis, fragrance formulation, or as an intermediate in the production of more complex molecules. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance.

Formula: C₁₅H₂₂O

InChI: InChI=1/C15H22O/c1-5-15(3,4)14-8-6-13(7-9-14)10-12(2)11-16/h6-9,11-12H,5,10H2,1-4H3

SMILES: CCC(C)(C)c1ccc(cc1)CC(C)C=O

4-(1,1-Dimethylpropyl)-α-methyl-benzenepropanal

CAS: 67467-96-3

Formula: C₁₅H₂₂O

Color and Shape: Neat

Molecular weight: 218.33

Ref: TR-D478038

4-(1,1-Dimethylpropyl)-α-methyl-benzenepropanal

CAS: 67467-96-3

4-(1,1-Dimethylpropyl)-alpha-methyl-benzenepropanal is a synthetic compound that is used as an impurity standard for the measurement of purity in drug products. It can also be used to monitor the metabolism of drugs, and may contribute to their side effects. 4-(1,1-Dimethylpropyl)-alpha-methyl-benzenepropanal has shown little evidence of toxicity in animal studies.

Formula: C₁₅H₂₂O

Purity: Min. 95%

Molecular weight: 218.33 g/mol

Ref: 3D-SCA46796