CAS 6747-15-5
:amino(1H-indol-3-yl)acetic acid
Description:
Amino(1H-indol-3-yl)acetic acid, commonly known as tryptophan, is an essential amino acid that plays a crucial role in protein synthesis and serves as a precursor for several important biomolecules, including serotonin and melatonin. This compound features an indole ring structure, which contributes to its aromatic properties and biological activity. Tryptophan is characterized by its ability to absorb ultraviolet light, making it useful in various biochemical assays. It is soluble in water and exhibits a zwitterionic form at physiological pH, which influences its interactions in biological systems. Tryptophan is also involved in various metabolic pathways, including the kynurenine pathway, which is significant for neurobiology and immune response. Additionally, it is known for its role in mood regulation and sleep patterns, highlighting its importance in both nutrition and mental health. As a dietary component, tryptophan is found in various protein-rich foods, such as turkey, chicken, dairy products, and nuts, making it an essential nutrient for human health.
Formula:C10H10N2O2
InChI:InChI=1/C10H10N2O2/c11-9(10(13)14)7-5-12-8-4-2-1-3-6(7)8/h1-5,9,12H,11H2,(H,13,14)
SMILES:c1ccc2c(c1)c(c[nH]2)C(C(=O)O)N
Synonyms:- 2-(Indole-3-yl)glycine
- Amino-(1H-Indol-3-Yl)-Acetic Acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
DL-3-Indolylglycine
CAS:D,L-3-indolylglycine, a tryptophan analog, is used in protein design and can replace tryptophan in peptidomimetics.Formula:C10H10N2O2Color and Shape:SolidMolecular weight:190.1986D,L-3-Indolylglycine
CAS:D,L-3-Indolylglycine is a fine chemical that is a versatile building block in organic synthesis. It is used as a reagent and reaction component in the manufacture of pharmaceuticals and other useful compounds. D,L-3-Indolylglycine has been shown to be useful for the synthesis of beta-carbolines, indole alkaloids and cyclic peptides. This compound has also been found to have anti-inflammatory properties.Formula:C10H10N2O2Purity:Min. 95%Color and Shape:PowderMolecular weight:190.2 g/molD,L-3-Indolylglycine
CAS:Controlled ProductStability Temperature Senstive
Applications D,L-3-Indolylglycine (cas# 6747-15-5) is a compound useful in organic synthesis.
References J. Chem. Soc., 458 (1940)Formula:C10H10N2O2Color and Shape:NeatMolecular weight:190.2





