CAS 67472-42-8
:1-O-{2-[2-(4-chlorophenyl)-1,3-benzoxazol-5-yl]propanoyl}-beta-D-glucopyranuronic acid
Description:
1-O-{2-[2-(4-chlorophenyl)-1,3-benzoxazol-5-yl]propanoyl}-beta-D-glucopyranuronic acid is a complex organic compound characterized by its unique structural features, which include a glucopyranuronic acid moiety linked to a benzoxazole derivative. The presence of the 4-chlorophenyl group contributes to its aromatic properties, while the benzoxazole ring enhances its potential for biological activity, possibly influencing its interactions with various biological targets. This compound is likely to exhibit solubility in polar solvents due to the glucuronic acid component, which contains multiple hydroxyl groups. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, given the presence of functional groups that may facilitate interactions with biological systems. Additionally, the compound's specific CAS number, 67472-42-8, allows for precise identification and retrieval of data related to its properties, synthesis, and potential uses in research and industry. Overall, this compound represents a fascinating intersection of carbohydrate chemistry and heterocyclic compounds, warranting further investigation into its properties and applications.
Formula:C22H20ClNO9
InChI:InChI=1/C22H20ClNO9/c1-9(21(30)33-22-17(27)15(25)16(26)18(32-22)20(28)29)11-4-7-14-13(8-11)24-19(31-14)10-2-5-12(23)6-3-10/h2-9,15-18,22,25-27H,1H3,(H,28,29)/t9?,15-,16-,17+,18-,22-/m0/s1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Benoxaprofen Glucuronide
CAS:Controlled ProductStability Hygroscopic
Applications Benoxaprofen Glucuronide is an antiinflammatory NSAID.
References Okada, K. et al.: Pharmazie., 66, 777 (2011); Dong, J. et al.: Drug Metab. Disp., 37, 2314 (2009);Formula:C22H20ClNO9Color and Shape:NeatMolecular weight:477.85
