CAS 67472-43-9

5-ethoxy-1,2,4-thiadiazole-3-carboxylic acid

Description:

5-Ethoxy-1,2,4-thiadiazole-3-carboxylic acid is a heterocyclic compound characterized by the presence of a thiadiazole ring, which is a five-membered ring containing two nitrogen atoms and one sulfur atom. This compound features an ethoxy group (-OCH2CH3) attached to the thiadiazole ring, contributing to its solubility and reactivity. The carboxylic acid functional group (-COOH) at the 3-position of the thiadiazole ring imparts acidic properties, allowing it to participate in various chemical reactions, such as esterification and amidation. The presence of both the ethoxy and carboxylic acid groups enhances its potential applications in pharmaceuticals and agrochemicals, as these functional groups can influence biological activity and solubility. Additionally, the compound may exhibit interesting properties such as antimicrobial or herbicidal activity, making it a subject of interest in research and development. Overall, 5-ethoxy-1,2,4-thiadiazole-3-carboxylic acid is a versatile compound with potential utility in various chemical and biological applications.

Formula: C₅H₆N₂O₃S

InChI: InChI=1/C5H6N2O3S/c1-2-10-5-6-3(4(8)9)7-11-5/h2H2,1H3,(H,8,9)

SMILES: CCOc1nc(C(=O)O)ns1

Synonyms:

• 1,2,4-Thiadiazole-3-carboxylic acid, 5-ethoxy-
• T5Ns Dnj Co2 Evq
• 5-Ethoxy-1,2,4-thiadiazole-3-carboxylic acid

3-Destrichloromethyl 3-Etridiazole Acid

Controlled Product

CAS: 67472-43-9

Formula: C₅H₆N₂O₃S

Color and Shape: Neat

Molecular weight: 174.18

Ref: TR-D297845

5-Ethoxy-1,2,4-thiadiazole-3-carboxylic acid

CAS: 67472-43-9

5-Ethoxy-1,2,4-thiadiazole-3-carboxylic acid (ETT) is a metabolite of etridiazole. Etridiazole is an antihelminthic drug that is used in the treatment of intestinal roundworm infections. ETT has been shown to be excreted in urine and can be used as an analytical marker for monitoring etridazole use.

Formula: C₅H₆N₂O₃S

Purity: Min. 95%

Molecular weight: 174.18 g/mol

Ref: 3D-SCA47243