CAS 674783-97-2: 10-methyl-9-(2,4,6-trimethylphenyl)acridinium perchlorate
Description:10-Methyl-9-(2,4,6-trimethylphenyl)acridinium perchlorate is a synthetic organic compound characterized by its acridinium structure, which is a derivative of acridine. This compound features a methyl group at the 10-position and a bulky 2,4,6-trimethylphenyl substituent at the 9-position, contributing to its unique electronic and steric properties. The perchlorate anion, derived from perchloric acid, is known for its strong oxidizing capabilities. As a result, this compound may exhibit interesting photophysical properties, making it potentially useful in applications such as photochemistry, fluorescence, and as a probe in various chemical reactions. The presence of the methyl groups enhances the solubility and stability of the compound in organic solvents. Additionally, due to the acridinium moiety, it may participate in electron transfer processes, which can be relevant in the development of sensors or in organic light-emitting devices. However, handling should be done with care due to the potential hazards associated with perchlorate compounds, including their reactivity and environmental impact.
Formula:C23H22ClNO4
InChI:InChI=1/C23H22N.ClHO4/c1-15-13-16(2)22(17(3)14-15)23-18-9-5-7-11-20(18)24(4)21-12-8-6-10-19(21)23;2-1(3,4)5/h5-14H,1-4H3;(H,2,3,4,5)/q+1;/p-1
- Synonyms:
- 9-Mesityl-10-methylacridinium Perchlorate