CAS 6748-70-5

1,1-bis(ethylsulfanyl)hexane-2,3,4,5-tetrol (non-preferred name)

Description:

1,1-bis(ethylsulfanyl)hexane-2,3,4,5-tetrol, also known by its CAS number 6748-70-5, is a chemical compound characterized by its unique structure that includes a hexane backbone with multiple hydroxyl (–OH) groups and ethylsulfanyl (–S(C2H5)2) substituents. This compound features four hydroxyl groups located at the 2, 3, 4, and 5 positions of the hexane chain, contributing to its classification as a tetrol. The presence of the ethylsulfanyl groups enhances its solubility in organic solvents and may impart specific reactivity due to the sulfur atoms. The hydroxyl groups suggest that the compound can engage in hydrogen bonding, which may influence its physical properties, such as boiling point and solubility in water. Additionally, the presence of multiple functional groups indicates potential applications in organic synthesis or as a building block in the development of more complex molecules. However, detailed information regarding its reactivity, stability, and specific applications may require further investigation in specialized chemical literature.

Formula: C₁₀H₂₂O₄S₂

InChI: InChI=1/C10H22O4S2/c1-6(11)7(12)8(13)9(14)10(15(2)3)16(4)5/h6-14H,2,4H2,1,3,5H3

SMILES: CC(C(C(C(C(S(=C)C)S(=C)C)O)O)O)O

Synonyms:

• L-Rhamnose Diethylmercaptal

L-Rhamnose diethyl mercaptal

CAS: 6748-70-5

Molecular weight: 270.41

Ref: 7W-GC2323

L-Rhamnose diethyl mercaptal

CAS: 6748-70-5

L-Rhamnose diethyl mercaptal is an antiperspirant and deodorant that is used in combination with other ingredients to reduce or eliminate body odor. It is a supplement, often found in combinations with other compounds such as neodymium and radium. This compound works by preventing the formation of sweat from the apocrine glands, which reduces underarm wetness and body odor. L-Rhamnose diethyl mercaptal also has antimicrobial properties that help prevent bacterial growth on the skin surface.

Formula: C₁₀H₂₂O₄S₂

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 270.41 g/mol

Ref: 3D-MR05237

L-Rhamnose Diethyl Dithioacetal

Controlled Product

CAS: 6748-70-5

Formula: C₁₀H₂₂O₄S₂

Color and Shape: Neat

Molecular weight: 270.41

Ref: TR-R315050