CAS 6748-91-0
:methyl 2,3-di-O-benzoyl-4,6-O-benzylidenehexopyranoside
Description:
Methyl 2,3-di-O-benzoyl-4,6-O-benzylidenehexopyranoside is a complex organic compound primarily used in organic synthesis and carbohydrate chemistry. It is characterized by its structure, which includes a hexopyranoside backbone modified with two benzoyl groups at the 2 and 3 positions and a benzylidene group at the 4 and 6 positions. This compound is typically a white to off-white crystalline solid, exhibiting good solubility in organic solvents such as chloroform and methanol, but limited solubility in water due to its hydrophobic aromatic groups. The presence of multiple functional groups allows for various chemical reactivity, making it a valuable intermediate in the synthesis of more complex molecules. Its stability under standard laboratory conditions is generally good, although it should be handled with care due to the potential reactivity of the carbonyl groups. Additionally, it may exhibit specific optical activity, which can be useful in determining its purity and concentration in solution.
Formula:C28H26O8
InChI:InChI=1/C28H26O8/c1-31-28-24(35-26(30)19-13-7-3-8-14-19)23(34-25(29)18-11-5-2-6-12-18)22-21(33-28)17-32-27(36-22)20-15-9-4-10-16-20/h2-16,21-24,27-28H,17H2,1H3/t21-,22+,23-,24-,27?,28-/m0/s1
Synonyms:- 8-(Benzoyloxy)-6-Methoxy-2-Phenylhexahydropyrano[3,2-D][1,3]Dioxin-7-Yl Benzoate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Methyl 2,3-Di-O-benzoyl-4,6-O-benzylidene-α-D-glucopyranoside
CAS:Formula:C28H26O8Purity:>98.0%(HPLC)Color and Shape:White to Almost white powder to crystalMolecular weight:490.51Methyl 2,3-di-o-benzoyl-4,6-o-benzylidene-α-d-glucopyranoside
CAS:Formula:C28H26O8Purity:98%Color and Shape:SolidMolecular weight:490.5012Methyl 2,3-Di-O-benzoyl-4,6-O-benzylidene-α-D-glucopyranoside
CAS:Methyl 2,3-Di-O-benzoyl-4,6-O-benzylidene-α-D-glucopyranosidePurity:>98.0%Methyl 2,3-di-O-benzoyl-4,6-O-benzylidene-a-D-glucopyranoside
CAS:Methyl 2,3-di-O-benzoyl-4,6-O-benzylidene-a-D-glucopyranoside is a synthetic compound that has been shown to be an inhibitor of the receptor for the proinflammatory cytokine TNF. It has been proposed as a possible treatment for chronic kidney disease, acute phase, and neurodegenerative diseases such as chronic pain. Methyl 2,3-di-O-benzoyl-4,6-O-benzylidene-a-D-glucopyranoside is an inhibitor of factor receptors and inhibits the activation of NFκB in a dose dependent manner. This inhibition leads to decreased production of proinflammatory cytokines such as TNF.Formula:C28H26O8Purity:Min. 95%Color and Shape:PowderMolecular weight:490.5 g/mol





