CAS 67482-49-9
:4,5-dichlorothiophene-2-carbaldehyde
Description:
4,5-Dichlorothiophene-2-carbaldehyde is an organic compound characterized by its thiophene ring structure, which is a five-membered aromatic heterocycle containing sulfur. This compound features two chlorine substituents at the 4 and 5 positions of the thiophene ring, contributing to its reactivity and potential applications in various chemical reactions. The aldehyde functional group at the 2-position enhances its electrophilic character, making it useful in synthetic organic chemistry, particularly in the synthesis of more complex molecules. The presence of chlorine atoms can also influence the compound's physical properties, such as solubility and boiling point, as well as its reactivity in nucleophilic substitution reactions. 4,5-Dichlorothiophene-2-carbaldehyde may be utilized in the development of agrochemicals, pharmaceuticals, and materials science due to its unique structural features. Safety and handling precautions should be observed, as halogenated compounds can pose environmental and health risks.
Formula:C5H2Cl2OS
InChI:InChI=1/C5H2Cl2OS/c6-4-1-3(2-8)9-5(4)7/h1-2H
SMILES:c1c(C=O)sc(c1Cl)Cl
Synonyms:- 2-Formyl-4,5-dichlorothiophene
- 2-Thiophenecarboxaldehyde, 4,5-dichloro-
- 4,5-Dichloro-2-thiophenecarboxaldehyde
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
4,5-Dichlorothiophene-2-carbaldehyde
CAS:<p>4,5-Dichlorothiophene-2-carbaldehyde is a terpene that has two chlorine atoms attached to it. It is an alkylbenzenes with the molecular formula C6H3Cl2. It is made up of two isomers and has a boiling point of 146.4°C. The compound was studied by scientists who found that it had mutagenic activity. When tested on bacteria, it was found to have a mutagenic effect on the genetic material as well as the ability to induce mutations in the bacterial chromosome. 4,5-Dichlorothiophene-2-carbaldehyde can be used for scientific purposes such as analyzing its spectra and chromatograms.</p>Formula:C5H2Cl2OSPurity:Min. 95%Molecular weight:181.04 g/mol
