CAS 67487-35-8

2,5-Dichlorobenzhydrazide

Description:

2,5-Dichlorobenzhydrazide is an organic compound characterized by its hydrazide functional group attached to a dichlorobenzene moiety. It typically appears as a white to off-white crystalline solid and is known for its stability under standard conditions. The compound is soluble in organic solvents such as ethanol and acetone but has limited solubility in water. Its chemical structure includes two chlorine atoms positioned at the 2 and 5 positions of the benzene ring, which significantly influences its reactivity and properties. 2,5-Dichlorobenzhydrazide is primarily utilized in agricultural applications, particularly as a herbicide and plant growth regulator. It functions by inhibiting specific biochemical pathways in plants, thereby affecting their growth and development. Additionally, it may exhibit antimicrobial properties, making it of interest in various industrial applications. As with many chemical substances, proper handling and safety precautions are essential due to potential toxicity and environmental impact.

Formula: C₇H₆Cl₂N₂O

InChI: InChI=1/C7H6Cl2N2O/c8-4-1-2-6(9)5(3-4)7(12)11-10/h1-3H,10H2,(H,11,12)

SMILES: c1cc(c(cc1Cl)C(=NN)O)Cl

Synonyms:

• 2,5-Dichlorobenzoic acid hydrazide
• 2,5-Dichlorobenzohydrazide

2,5-Dichlorobenzhydrazide

CAS: 67487-35-8

Formula: C₇H₆Cl₂N₂O

Purity: 98%

Color and Shape: Solid

Molecular weight: 205.0413

Ref: IN-DA003FXA

2,5-Dichlorobenzhydrazide

CAS: 67487-35-8

2,5-Dichlorobenzhydrazide

Purity: 97%

Molecular weight: 205.04134g/mol

Ref: 54-OR11104

2,5-Dichlorobenzohydrazide

CAS: 67487-35-8

2,5-Dichlorobenzohydrazide

Purity: 97%

Molecular weight: 205.044g/mol

Ref: 54-OR96818

2,5-Dichlorobenzhydrazide

CAS: 67487-35-8

2,5-Dichlorobenzhydrazide is a fine chemical that can be used as a building block in the synthesis of other chemicals. It is also a reagent and speciality chemical that is used in research. 2,5-Dichlorobenzhydrazide has been shown to react with many different compounds, making it a versatile building block or reaction component in chemical reactions. 2,5-Dichlorobenzhydrazide is also an important intermediate or scaffold for complex compounds.

Formula: C₇H₆Cl₂N₂O

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 205.04 g/mol

Ref: 3D-FD69973

2,5-Dichlorobenzhydrazide

CAS: 67487-35-8

Formula: C₇H₆Cl₂N₂O

Purity: 98%

Color and Shape: Solid

Molecular weight: 205.04

Ref: 10-F018513