CymitQuimica logo

CAS 67490-21-5

:

2,4,6-Tris(1,1-dimethylethyl)pyrimidine

Description:
2,4,6-Tris(1,1-dimethylethyl)pyrimidine, with the CAS number 67490-21-5, is a chemical compound characterized by its pyrimidine ring substituted with three bulky tert-butyl groups at the 2, 4, and 6 positions. This structure imparts significant steric hindrance, influencing its reactivity and solubility. The tert-butyl groups enhance the compound's hydrophobicity, making it less soluble in polar solvents while increasing its stability against oxidation and thermal degradation. This compound is often utilized as an antioxidant in various applications, particularly in plastics and rubber, where it helps to prevent degradation from heat and light exposure. Additionally, its unique structure may contribute to its potential use in various chemical syntheses and as a stabilizer in formulations. The presence of the pyrimidine moiety also suggests potential biological activity, although specific pharmacological properties would require further investigation. Overall, 2,4,6-Tris(1,1-dimethylethyl)pyrimidine is notable for its stability and utility in enhancing the longevity of materials.
Formula:C16H28N2
InChI:InChI=1S/C16H28N2/c1-14(2,3)11-10-12(15(4,5)6)18-13(17-11)16(7,8)9/h10H,1-9H3
InChI key:InChIKey=VYWSYEDVFVGRGG-UHFFFAOYSA-N
SMILES:C(C)(C)(C)C=1C=C(C(C)(C)C)N=C(C(C)(C)C)N1
Synonyms:
  • 2,4,6-Tri-tert-butylpyrimidine
  • Pyrimidine, 2,4,6-tris(1,1-dimethylethyl)-
  • 2,4,6-Tris(1,1-dimethylethyl)pyrimidine
  • 2,4,6-Tritert-butylpyrimidine
Found 6 products.