CAS 67491-43-4
:2,2'-bipyridine-4,4'-dicarbonitrile
Description:
2,2'-Bipyridine-4,4'-dicarbonitrile is an organic compound characterized by its bipyridine structure, which consists of two pyridine rings connected at the 2 and 2' positions, with cyano groups (-C≡N) attached at the 4 and 4' positions of the rings. This compound typically exhibits a high degree of stability due to the aromatic nature of the bipyridine framework. The presence of the cyano groups contributes to its electron-withdrawing properties, making it a useful ligand in coordination chemistry and catalysis. It is often employed in the synthesis of metal complexes, which can exhibit interesting electronic and photophysical properties. Additionally, 2,2'-bipyridine-4,4'-dicarbonitrile may show solubility in polar organic solvents, and its reactivity can be influenced by the presence of the cyano groups, allowing for various chemical transformations. Overall, this compound is significant in research and applications involving coordination compounds and materials science.
Formula:C12H6N4
InChI:InChI=1/C12H6N4/c13-7-9-1-3-15-11(5-9)12-6-10(8-14)2-4-16-12/h1-6H
SMILES:c1cnc(cc1C#N)c1cc(ccn1)C#N
Synonyms:- 2,2'-Bipyridin-4,4'-dicarbonitril
- 4,4'-Dicyano-2,2'-bipyridine
- 67491-43-4
- [2,2'-bipyridine]-4,4'-dicarbonitrile
- 2,2'-Bipyridine-4,4'-dicarbonitrile
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
[2,2'-Bipyridine]-4,4'-dicarbonitrile
CAS:Formula:C12H6N4Purity:95%Color and Shape:SolidMolecular weight:206.20282,2’-Bipyridine-4,4’-dicarbonitrile
CAS:2,2’-Bipyridine-4,4’-dicarbonitrilePurity:97%Molecular weight:206.20g/mol4,4'-Dicyano-2,2'-bipyridine
CAS:4,4'-Dicyano-2,2'-bipyridine is a ligand that binds to molybdenum and has been used in the diagnosis of mitochondrial DNA. It has been shown to be an effective treatment for tropical diseases such as malaria. This drug binds to the molybdenum cofactor in the enzyme ribonucleotide reductase, thereby inhibiting the production of ATP. 4,4'-Dicyano-2,2'-bipyridine also reacts with formic acid and ruthenium to produce a redshifted product that can be detected by electron paramagnetic resonance spectroscopy.
Formula:C12H6N4Purity:Min. 98 Area-%Color and Shape:PowderMolecular weight:206.2 g/mol2-(4-Cyanopyridin-2-yl)pyridine-4-carbonitrile
CAS:Formula:C12H6N4Purity:95%Color and Shape:Liquid, No data available.Molecular weight:206.2084,4'-Dicyano-2,2'-bipyridine
CAS:Controlled ProductApplications 4,4'-Dicyano-2,2'-bipyridine is a photosensitizers for solar fuel generation
References Mills, I. N., et al.: Polyhedron, 82, 104 (2014)Formula:C12H6N4Color and Shape:NeatMolecular weight:405.914





