CymitQuimica logo

CAS 67500-19-0

:

5'-Amino-2'-fluoroacetophenone

Description:
5'-Amino-2'-fluoroacetophenone is an organic compound characterized by the presence of an amino group and a fluorinated acetophenone structure. It features a fluorine atom at the 2' position of the aromatic ring, which can influence its reactivity and biological activity. The amino group at the 5' position enhances its potential as a building block in pharmaceuticals and agrochemicals, as it can participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the amino group. Its unique structural features make it a valuable intermediate in organic synthesis, particularly in the development of compounds with potential therapeutic applications. Additionally, the presence of the fluorine atom can enhance lipophilicity and metabolic stability, which are important factors in drug design. As with many chemical substances, safety precautions should be observed when handling this compound, as it may pose health risks if ingested or inhaled.
Formula:C8H8FNO
InChI:InChI=1S/C8H8FNO/c1-5(11)7-4-6(10)2-3-8(7)9/h2-4H,10H2,1H3
InChI key:WYTBQTMYNBKLHE-UHFFFAOYSA-N
SMILES:CC(=O)C1=C(C=CC(=C1)N)F
Synonyms:
  • 5-Amino-2-fluoroacetophenone
Found 4 products.