CAS 675109-26-9

6-bromoisoindolin-1-one

Description:

6-Bromoisoindolin-1-one is a chemical compound characterized by its isoindoline structure, which features a bicyclic framework consisting of a benzene ring fused to a five-membered nitrogen-containing ring. The presence of a bromine atom at the 6-position of the isoindoline ring significantly influences its chemical reactivity and properties. This compound typically exhibits a solid state at room temperature and is often used in organic synthesis and medicinal chemistry due to its potential biological activity. The bromine substituent can enhance the compound's reactivity in electrophilic aromatic substitution reactions and can also serve as a handle for further functionalization. Additionally, 6-bromoisoindolin-1-one may exhibit interesting photophysical properties, making it a candidate for applications in materials science and drug development. Its molecular structure allows for various interactions, including hydrogen bonding and π-π stacking, which can be relevant in biological systems and material applications. As with many organic compounds, proper handling and safety precautions are essential due to potential toxicity and reactivity.

Formula: C₈H₆BrNO

InChI: InChI=1/C8H6BrNO/c9-6-2-1-5-4-10-8(11)7(5)3-6/h1-3H,4H2,(H,10,11)

SMILES: c1cc(cc2c1CN=C2O)Br

Synonyms:

• 6-bromo-2,3-dihydro-1H-isoindol-1-one
• 1H-Isoindol-1-one, 6-bromo-2,3-dihydro-

6-Bromoisoindolin-1-one

CAS: 675109-26-9

Formula: C₈H₆BrNO

Purity: 97%

Color and Shape: Solid

Molecular weight: 212.0433

Ref: IN-DA003N3N

6-Bromo-2,3-dihydro-1H-isoindol-1-one

CAS: 675109-26-9

6-Bromo-2,3-dihydro-1H-isoindol-1-one

Formula: C₈H₆BrNO

Purity: 97%

Color and Shape: white to off-white solid

Molecular weight: 212.04g/mol

Ref: 54-OR305290

6-Bromoisoindolin-1-one

CAS: 675109-26-9

Formula: C₈H₆BrNO

Purity: 95%

Color and Shape: Solid, White powder

Molecular weight: 212.046

Ref: 10-F079798