CAS 675126-08-6
:(1R,4S)-4-(3,4-dichlorophenyl)tetralin-1-amine hydrochloride
Description:
(1R,4S)-4-(3,4-dichlorophenyl)tetralin-1-amine hydrochloride is a chemical compound characterized by its specific stereochemistry and functional groups. It features a tetralin core, which is a bicyclic structure consisting of a benzene ring fused to a cyclohexane ring. The presence of the 3,4-dichlorophenyl group indicates that two chlorine atoms are substituted on the phenyl ring, which can significantly influence the compound's biological activity and lipophilicity. The amine functional group suggests potential for hydrogen bonding and interaction with biological targets, making it of interest in medicinal chemistry. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its bioavailability. The compound's stereochemistry, denoted by the (1R,4S) configuration, may also play a crucial role in its pharmacological properties, affecting how it interacts with receptors or enzymes in biological systems. Overall, this compound's unique structural features contribute to its potential applications in research and therapeutic contexts.
Formula:C16H16Cl3N
InChI:InChI=1/C16H15Cl2N.ClH/c17-14-7-5-10(9-15(14)18)11-6-8-16(19)13-4-2-1-3-12(11)13;/h1-5,7,9,11,16H,6,8,19H2;1H/t11-,16+;/m0./s1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
(1R,4S)-N-Desmethyl Sertraline Hydrochloride
CAS:Formula:C16H16Cl3NPurity:98%Color and Shape:SolidMolecular weight:328.6639Sertraline Impurity 4 HCl
CAS:Formula:C16H15Cl2N·HClColor and Shape:White To Off-White SolidMolecular weight:292.21 36.46Dasotraline hydrochloride
CAS:Dasotraline hydrochloride, a dopamine, norepinephrine, and serotonin reuptake inhibitor with IC50s: 4, 6, 11 nM.Formula:C16H16Cl3NPurity:98.92% - 99.6%Color and Shape:SolidMolecular weight:328.66(1R,4S)-N-Desmethyl Sertraline Hydrochloride
CAS:Controlled ProductFormula:C16H15Cl2N·ClHColor and Shape:NeatMolecular weight:328.66(1R,4S)-N-Desmethyl sertraline hydrochloride
CAS:Sertraline metaboliteFormula:C16H16Cl3NPurity:Min. 95%Color and Shape:PowderMolecular weight:328.66 g/mol







