CAS 675137-59-4

4-[(dipropylamino)methyl]benzoic acid

Description:

4-[(Dipropylamino)methyl]benzoic acid, identified by its CAS number 675137-59-4, is an organic compound characterized by its benzoic acid structure modified with a dipropylamino group. This compound typically exhibits properties associated with both aromatic and amine functionalities, which can influence its solubility, reactivity, and biological activity. It is likely to be a solid at room temperature, with potential applications in pharmaceuticals or as a chemical intermediate due to its ability to interact with biological systems. The presence of the dipropylamino group suggests that it may exhibit basic properties, allowing it to form salts or complexes with acids. Additionally, the carboxylic acid functional group contributes to its acidity and potential for hydrogen bonding, which can affect its solubility in polar solvents. Overall, the unique combination of functional groups in 4-[(dipropylamino)methyl]benzoic acid makes it a compound of interest in various chemical and biological contexts.

Formula: C₁₄H₂₁NO₂

InChI: InChI=1/C14H21NO2/c1-3-9-15(10-4-2)11-12-5-7-13(8-6-12)14(16)17/h5-8H,3-4,9-11H2,1-2H3,(H,16,17)

SMILES: CCCN(CCC)Cc1ccc(cc1)C(=O)O

4-[(dipropylamino)methyl]benzoic acid hydrochloride

CAS: 675137-59-4

Formula: C₁₄H₂₂ClNO₂

Purity: 95.0%

Molecular weight: 271.79

Ref: 10-F361551