CAS 67515-59-7
:4-fluoro-3-(trifluoromethyl)benzonitrile
Description:
4-Fluoro-3-(trifluoromethyl)benzonitrile, with the CAS number 67515-59-7, is an aromatic nitrile compound characterized by the presence of a cyano group (-C≡N) attached to a benzene ring that also features a fluorine atom and a trifluoromethyl group (-CF3). This compound typically exhibits a high degree of lipophilicity due to the presence of multiple fluorine atoms, which can influence its solubility and reactivity. The trifluoromethyl group is known for its electron-withdrawing properties, which can enhance the acidity of adjacent hydrogen atoms and affect the compound's reactivity in nucleophilic substitution reactions. Additionally, the presence of the cyano group contributes to the compound's potential as a building block in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. The compound may also exhibit interesting physical properties, such as a relatively high boiling point and stability under various conditions, making it suitable for various applications in chemical research and industry.
Formula:C8H3F4N
InChI:InChI=1/C8H3F4N/c9-7-2-1-5(4-13)3-6(7)8(10,11)12/h1-3H
SMILES:c1cc(c(cc1C#N)C(F)(F)F)F
Synonyms:- 3-(Trifluoromethyl)-4-Fluorobenzonitrile
- 5-Cyano-2-Fluorobenzotrifluoride
- Buttpark 45\01-76
- 5-Cyano-2-fluorobenzotrifluoride~alpha,alpha,alpha,4-Tetrafluoro-m-tolunitrile
- 4-Fluoro-3-(Trifluromethyl)Benzonitrile
- 4-Fluoro-3-Trifluoromethylbenzonitrile
- À,À,À,4-Tetrafluoro-M-Tolunitrile
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
4-fluoro-3-(trifluoromethyl)benzonitrile
CAS:Formula:C8H3F4NPurity:98%Color and Shape:SolidMolecular weight:189.10974-Fluoro-3-(trifluoromethyl)benzonitrile
CAS:4-Fluoro-3-(trifluoromethyl)benzonitrileFormula:C8H3F4NPurity:97%Color and Shape: faint brown with dark spec crystalsMolecular weight:189.11g/mol4-Fluoro-3-(trifluoromethyl)benzonitrile
CAS:Formula:C8H3F4NPurity:>98.0%(GC)Color and Shape:White to Almost white powder to crystalMolecular weight:189.114-Fluoro-3-(trifluoromethyl)benzonitrile
CAS:4-Fluoro-3-(trifluoromethyl)benzonitrile is a metabolite of 4-fluoro-3-(trifluoromethyl)phenol, which is a metabolite of the sulfoxide drug pentoxyverine. It has shown to inhibit the growth of the nematode Ascaris suum in animals. This metabolic pathway has been studied using profiles from rat, mouse and human liver homogenates. The biotransformations that have been observed include sulfoxidation, hydroxylation, deacetylation and glucuronidation. The metabolic pathways for 4-fluoro-3-(trifluoromethyl)benzonitrile are similar to those of anthelmintic drugs such as levamisole and pyrantel. The 4-fluoro-3-(trifluoromethyl)benzonitrile can also be used as an enantiomerFormula:C8H3F4NPurity:Min. 95%Color and Shape:PowderMolecular weight:189.11 g/mol4-Fluoro-3-(trifluoromethyl)benzonitrile
CAS:Formula:C8H3F4NPurity:97.0%Color and Shape:SolidMolecular weight:189.113





