CAS 6752-16-5

1H-Pyrazolo[3,4-b]pyridin-3-amine

Description:

1H-Pyrazolo[3,4-b]pyridin-3-amine, with the CAS number 6752-16-5, is a heterocyclic organic compound that features a pyrazolo-pyridine structure. This compound is characterized by its fused pyrazole and pyridine rings, which contribute to its unique chemical properties. It typically appears as a solid at room temperature and is soluble in various organic solvents. The presence of an amino group at the 3-position of the pyridine ring enhances its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. This compound is of interest in medicinal chemistry due to its potential biological activities, including anti-inflammatory and anticancer properties. Its structural features allow for interactions with biological targets, making it a subject of research in drug development. Additionally, the compound's stability and reactivity can be influenced by substituents on the rings, which can be modified to optimize its pharmacological profile. Overall, 1H-Pyrazolo[3,4-b]pyridin-3-amine represents a versatile scaffold in organic synthesis and medicinal chemistry.

Formula: C₆H₆N₄

InChI: InChI=1/C6H6N4/c7-5-4-2-1-3-8-6(4)10-9-5/h1-3H,(H3,7,8,9,10)

SMILES: c1cc2c(N)[nH]nc2nc1

Synonyms:

• 3-Aminopyrazolo[3,4-b]pyridine

1H-Pyrazolo[3,4-b]pyridin-3-amine

CAS: 6752-16-5

Formula: C₆H₆N₄

Purity: 95%

Color and Shape: Solid

Molecular weight: 134.1386

Ref: IN-DA0038HO

3-Amino-1H-pyrazolo[3,4-b]pyridine

CAS: 6752-16-5

3-Amino-1H-pyrazolo[3,4-b]pyridine

Purity: 98%

Color and Shape: Powder

Molecular weight: 134.14g/mol

Ref: 54-OR0926

1H-Pyrazolo[3,4-b]pyridine-3-amine

CAS: 6752-16-5

1H-Pyrazolo[3,4-b]pyridine-3-amine (1HPP) is a β-unsaturated ketone that can be synthesized from nitrous acid and triazine. 1HPP has been shown to inhibit the growth of cancer cells by binding to the DNA and inhibiting transcription and replication. Its binding to DNA may be due to hydrogen bonding interactions with chloride ions, as well as the presence of functional groups such as a carbonyl group and nitro group. 1HPP also inhibits the activity of xanthine oxidase, an enzyme that catalyzes the oxidation of hypoxanthine to xanthine. This inhibition may be due to its ability to form a covalent bond with this enzyme's cofactor, NADPH.

Formula: C₆H₆N₄

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 134.14 g/mol

Ref: 3D-FP09386

3-Amino-pyrazolo[3,4-b]pyridine

CAS: 6752-16-5

Formula: C₆H₆N₄

Purity: 98%

Color and Shape: Solid

Molecular weight: 134.142

Ref: 10-F036480