CAS 6752-80-3
:(E)-Tagetone
Description:
(E)-Tagetone, with the CAS number 6752-80-3, is an organic compound characterized by its distinctive structure and properties. It is a ketone, specifically an enone, which means it contains both a carbonyl group (C=O) and a double bond (C=C) in its molecular framework. This compound is typically found in essential oils and is known for its pleasant, floral aroma, making it of interest in the fragrance and flavor industries. (E)-Tagetone is often associated with the scent of certain plants, contributing to their characteristic odors. Its molecular structure allows for various chemical reactions, including addition and oxidation, which can be exploited in synthetic organic chemistry. Additionally, (E)-Tagetone exhibits moderate volatility and solubility in organic solvents, which is typical for many ketones. Its potential applications extend beyond perfumery, as it may also serve as a precursor in the synthesis of other organic compounds. Overall, (E)-Tagetone is a versatile compound with notable sensory and chemical properties.
Formula:C10H16O
InChI:InChI=1S/C10H16O/c1-5-9(4)7-10(11)6-8(2)3/h5,7-8H,1,6H2,2-4H3/b9-7+
InChI key:InChIKey=RJXKHBTYHGBOKV-VQHVLOKHSA-N
SMILES:C(/C=C(/C=C)\C)(CC(C)C)=O
Synonyms:- trans-Tagetone
- 5,7-Octadien-4-one, 2,6-dimethyl-, (E)-
- (E)-2,6-Dimethylocta-5,7-dien-4-one
- Tagetone, trans-
- (5E)-2,6-Dimethyl-5,7-octadien-4-one
- 5,7-Octadien-4-one, 2,6-dimethyl-, (5E)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
