
CAS 67527-71-3
:Mildiomycin
Description:
Mildiomycin is a chemical compound classified as an antibiotic, primarily known for its use in agricultural applications, particularly in plant protection. It is produced by the fermentation of certain strains of the bacterium *Streptomyces*. Mildiomycin exhibits a broad spectrum of activity against various fungal pathogens, making it valuable in the management of plant diseases. The compound functions by inhibiting specific biochemical pathways in the target organisms, thereby disrupting their growth and reproduction. Mildiomycin is characterized by its relatively low toxicity to non-target organisms, which enhances its appeal as a biopesticide. Additionally, it is known for its stability under various environmental conditions, contributing to its effectiveness in field applications. The compound's mode of action and its efficacy against resistant strains of pathogens are areas of ongoing research, as scientists seek to optimize its use in sustainable agriculture. Overall, Mildiomycin represents a significant advancement in the development of environmentally friendly agricultural practices.
Formula:C19H30N8O9
InChI:InChI=1S/C19H30N8O9/c20-10(7-29)15(31)25-11-1-2-12(27-5-8(6-28)14(21)26-18(27)34)36-13(11)19(35,16(32)33)3-9(30)4-24-17(22)23/h1-2,5,9-13,28-30,35H,3-4,6-7,20H2,(H,25,31)(H,32,33)(H2,21,26,34)(H4,22,23,24)
InChI key:InChIKey=QKJJCZYFXJCKRX-UHFFFAOYSA-N
SMILES:C(CC(CNC(=N)N)O)(C(O)=O)(O)C1C(NC(C(CO)N)=O)C=CC(O1)N2C=C(CO)C(N)=NC2=O
Synonyms:- 4-Amino-1-[4-[[(2S)-2-amino-3-hydroxy-1-oxopropyl]amino]-9-[(aminoiminomethyl)amino]-6-C-carboxy-2,3,4,7,9-pentadeoxy-α-L-talo-non-2-enopyranosyl]-5-(hydroxymethyl)-2(1H)-pyrimidinone
- Mildiomycin
- 2(1H)-Pyrimidinone, 4-amino-1-[4-[[(2S)-2-amino-3-hydroxy-1-oxopropyl]amino]-9-[(aminoiminomethyl)amino]-6-C-carboxy-2,3,4,7,9-pentadeoxy-α-L-talo-non-2-enopyranosyl]-5-(hydroxymethyl)-
- 2(1H)-Pyrimidinone, 4-amino-1-[4-[(2-amino-3-hydroxy-1-oxopropyl)amino]-9-[(aminoiminomethyl)amino]-6-C-carboxy-2,3,4,7,9-pentadeoxy-α-L-talo-non-2-enopyranosyl]-5-(hydroxymethyl)-, (S)-
- TF 138
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Mildiomycin
CAS:Mildiomycin, an antibiotic from Streptoverticillium, targets barley mildew, some Mycobacterium, Rhodotorula, but not most fungi/bacteria.Formula:C19H30N8O9Color and Shape:SolidMolecular weight:514.49
