CAS 67531-86-6

6-Fluorosalicylic acid

Description:

6-Fluorosalicylic acid is an aromatic organic compound characterized by the presence of both a fluorine atom and a carboxylic acid functional group attached to a salicylic acid backbone. Its molecular structure features a fluorine substituent at the 6-position of the aromatic ring, which influences its chemical reactivity and properties. This compound typically appears as a white to off-white solid and is soluble in polar solvents, such as water and alcohols, due to the presence of the carboxylic acid group. 6-Fluorosalicylic acid is of interest in various fields, including medicinal chemistry and materials science, due to its potential applications in drug development and as a building block for synthesizing more complex molecules. The presence of the fluorine atom can enhance biological activity and alter the physicochemical properties of the compound, making it a subject of research in the development of pharmaceuticals. As with many chemical substances, proper handling and safety precautions are essential due to potential toxicity and environmental impact.

Formula: C₆H₃F₅N₂

InChI: InChI=1/C6H3F5N2/c7-3-1-2(6(9,10)11)4(8)5(12)13-3/h1H,(H2,12,13)

SMILES: c1c(c(c(N)nc1F)F)C(F)(F)F

Synonyms:

• 6-Fluoro-2-hydroxybenzoic acid
• 2-Fluoro-6-Hydroxybenzoic Acid
• 3,6-Difluoro-4-(Trifluoromethyl)Pyridin-2-Amine

2-Fluoro-6-hydoxybenzoic acid

CAS: 67531-86-6

Formula: C₇H₅FO₃

Purity: 96%

Color and Shape: Solid

Molecular weight: 156.1112

Ref: IN-DA0034D3

6-Fluorosalicylic Acid

CAS: 67531-86-6

Formula: C₇H₅FO₃

Purity: >98.0%(GC)(T)

Color and Shape: White to Light yellow to Light orange powder to crystal

Molecular weight: 156.11

Ref: 3B-F0553

2-Fluoro-6-hydroxybenzoic acid

CAS: 67531-86-6

2-Fluoro-6-hydroxybenzoic acid

Formula: C₇H₅FO₃

Purity: 98%

Color and Shape: fawn/beige crystalline powder

Molecular weight: 156.11g/mol

Ref: 54-PC3756B

2-Fluoro-6-hydroxybenzoic acid

CAS: 67531-86-6

2-Fluoro-6-hydroxybenzoic acid is a fluorescent compound that is commonly used as a reagent in organic synthesis. It has been shown to be an effective fungicide, and has also been shown to have pesticidal activity against various insects. The stability of 2-fluoro-6-hydroxybenzoic acid in water depends on the pH level; at low pH levels, it is stable and can be used as a fungicide, while at high pH levels, it is unstable and cannot be used as a fungicide. Studies have shown that 2-fluoro-6-hydroxybenzoic acid binds with hydrogen ions to form stable complexes, which may explain its pesticidal properties.

Formula: C₇H₅FO₃

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 156.11 g/mol

Ref: 3D-FF66786

6-Fluorosalicylic acid

CAS: 67531-86-6

Formula: C₇H₅FO₃

Purity: 96%

Color and Shape: Solid

Molecular weight: 156.112

Ref: 10-F006236