CAS 67534-81-0
:[3-(bromomethyl)-1-benzofuran-2-yl](phenyl)methanone
Description:
The chemical substance known as [3-(bromomethyl)-1-benzofuran-2-yl](phenyl)methanone, with the CAS number 67534-81-0, is a synthetic organic compound characterized by its complex structure that includes a benzofuran moiety and a phenyl group. This compound features a bromomethyl group, which enhances its reactivity and potential for further chemical modifications. It typically exhibits properties associated with aromatic compounds, such as stability and the ability to participate in electrophilic substitution reactions. The presence of the carbonyl group (ketone) contributes to its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic attacks. The compound may also display biological activity, which could be of interest in medicinal chemistry. Its solubility and stability in different solvents can vary, depending on the specific conditions and the presence of functional groups. Overall, this compound is significant in research contexts, particularly in the development of new materials or pharmaceuticals.
Formula:C16H11BrO2
InChI:InChI=1/C16H11BrO2/c17-10-13-12-8-4-5-9-14(12)19-16(13)15(18)11-6-2-1-3-7-11/h1-9H,10H2
Synonyms:- [3-(BROMOMETHYL)-1-BENZOFURAN-2-YL](PHENYL)METHANONE
- methanone, [3-(bromomethyl)-2-benzofuranyl]phenyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
(3-(Bromomethyl)benzofuran-2-yl)(phenyl)methanone
CAS:Formula:C16H11BrO2Color and Shape:SolidMolecular weight:315.1613
