CAS 67536-13-4
:(2E)-2-[2-(phthalazin-1-yl)hydrazinylidene]propanoic acid
Description:
(2E)-2-[2-(phthalazin-1-yl)hydrazinylidene]propanoic acid, with the CAS number 67536-13-4, is an organic compound characterized by its unique structural features, which include a propanoic acid backbone and a phthalazin moiety. This compound typically exhibits properties associated with both hydrazine and carboxylic acid functional groups, which can influence its reactivity and solubility. The presence of the phthalazin group may impart specific biological activities or interactions, making it of interest in medicinal chemistry. The compound is likely to be a solid at room temperature, with potential applications in pharmaceuticals or as a chemical intermediate. Its synthesis may involve the condensation of hydrazine derivatives with appropriate carbonyl compounds, and it may be characterized using techniques such as NMR spectroscopy, mass spectrometry, and infrared spectroscopy to confirm its structure and purity. Overall, this compound represents a class of hydrazone derivatives that can exhibit diverse chemical behavior due to their functional groups.
Formula:C11H10N4O2
InChI:InChI=1/C11H10N4O2/c1-7(11(16)17)13-15-10-9-5-3-2-4-8(9)6-12-14-10/h2-6H,1H3,(H,14,15)(H,16,17)/b13-7+
InChI key:InChIKey=CXGHHASVNBBLOU-UHFFFAOYSA-N
SMILES:N(N=C(C(O)=O)C)C=1C2=C(C=NN1)C=CC=C2
Synonyms:- Propanoic acid, 2-(1-phthalazinylhydrazono)-
- Pyruvic acid, 1-phthalazinylhydrazone
- 2-[2-(1-Phthalazinyl)hydrazinylidene]propanoic acid
- Hydralazine pyruvic acid hydrazone
- Propanoic acid, 2-[2-(1-phthalazinyl)hydrazinylidene]-
- Hydralazine Pyruvic Acid Hydrazone Q: What is the CAS Number of
- Hydralazine Pyruvic Acid Hydrazone Q: What is the storage condition of
- 1-Phthalazinylhydrazone Pyruvic Acid
- Hydralazine pyruvate hydrazone
- (2E)-2-(phthalazin-1-ylhydrazinylidene)propanoic acid
- Hydralazine Pyruvic Acid HydrazoneQ: What is
- Hydralazine Pyruvic Acid Hydrazone Q: What are the applications of
- 2-(1-Phthalazinylhydrazono)propanoic Acid
- See more synonyms
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
