CAS 67560-68-3
:[(2S,3R,4R)-4-(3,4-dimethoxybenzyl)-2-(3,4-dimethoxyphenyl)tetrahydrofuran-3-yl]methanol
Description:
The chemical substance with the name "[(2S,3R,4R)-4-(3,4-dimethoxybenzyl)-2-(3,4-dimethoxyphenyl)tetrahydrofuran-3-yl]methanol" and CAS number 67560-68-3 is a complex organic compound characterized by its tetrahydrofuran ring structure, which contributes to its cyclic nature and potential stereochemistry. The presence of multiple methoxy groups indicates that it has significant hydrophobic characteristics, which can influence its solubility and reactivity. The compound's stereochemistry, denoted by the (2S,3R,4R) configuration, suggests specific spatial arrangements of its substituents, which can affect its biological activity and interactions with other molecules. This compound may exhibit interesting pharmacological properties due to its structural features, making it a subject of interest in medicinal chemistry. Additionally, the methanol moiety suggests potential for hydrogen bonding, which could play a role in its solubility and interaction with biological targets. Overall, this compound's unique structure and functional groups position it as a potentially valuable entity in chemical research and applications.
Formula:C22H28O6
InChI:InChI=1/C22H28O6/c1-24-18-7-5-14(10-20(18)26-3)9-16-13-28-22(17(16)12-23)15-6-8-19(25-2)21(11-15)27-4/h5-8,10-11,16-17,22-23H,9,12-13H2,1-4H3/t16-,17-,22+/m0/s1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Lariciresinol dimethyl ether
CAS:Lariciresinol dimethyl ether is a natural product from Rostellularia procumbens.Formula:C22H28O6Purity:98%Color and Shape:SolidMolecular weight:388.45Lariciresinol dimethyl ether
CAS:Formula:C22H28O6Purity:95%~99%Color and Shape:PowderMolecular weight:388.46Lariciresinol dimethyl ether
CAS:Lariciresinol dimethyl ether is a naturally occurring lignan, which is a type of polyphenolic compound. It is primarily sourced from various plant species, including coniferous trees. These plants produce lignans as part of their secondary metabolism, which are then accumulated in the wood, bark, and leaves.
Formula:C22H28O6Purity:Min. 95%Molecular weight:388.5 g/molRef: 3D-SCA56068
Discontinued product




